About 1-N',1-N'-bis(2-aminoethyl)ethene-1,1-diamine
1-N',1-N'-bis(2-aminoethyl)ethene-1,1-diamine (PubChem CID 23165401) has the molecular formula C6H16N4
and a molecular weight of 144.22 g/mol. Its IUPAC name is 1-N',1-N'-bis(2-aminoethyl)ethene-1,1-diamine.
Molecular Properties
| Compound Name | 1-N',1-N'-bis(2-aminoethyl)ethene-1,1-diamine |
| PubChem CID | 23165401 |
| Molecular Formula | C6H16N4 |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.14 |
| IUPAC Name | 1-N',1-N'-bis(2-aminoethyl)ethene-1,1-diamine |
| SMILES | C=C(N)N(CCN)CCN |
| InChI | InChI=1S/C6H16N4/c1-6(9)10(4-2-7)5-3-8/h1-5,7-9H2 |
| InChIKey | UBHRMJWBICMZKC-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-N',1-N'-bis(2-aminoethyl)ethene-1,1-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N',1-N'-bis(2-aminoethyl)ethene-1,1-diamine?
The IUPAC name of 1-N',1-N'-bis(2-aminoethyl)ethene-1,1-diamine (CID 23165401) is 1-N',1-N'-bis(2-aminoethyl)ethene-1,1-diamine.
What is the SMILES notation for 1-N',1-N'-bis(2-aminoethyl)ethene-1,1-diamine?
The canonical SMILES for 1-N',1-N'-bis(2-aminoethyl)ethene-1,1-diamine is C=C(N)N(CCN)CCN.
What is the InChIKey of 1-N',1-N'-bis(2-aminoethyl)ethene-1,1-diamine?
The InChIKey is UBHRMJWBICMZKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16N4/c1-6(9)10(4-2-7)5-3-8/h1-5,7-9H2.
What are the key properties of 1-N',1-N'-bis(2-aminoethyl)ethene-1,1-diamine?
1-N',1-N'-bis(2-aminoethyl)ethene-1,1-diamine has a molecular weight of 144.22 g/mol, XLogP of -1.36, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N',1-N'-bis(2-aminoethyl)ethene-1,1-diamine is sourced from PubChem (CID 23165401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).