C12H9FN2O6 — CID 23165405
(6-fluoro-2',5'-dioxospiro[2,3-dihydrochromene-4,4'-imidazolidine]-2-yl) hydrogen carbonate (PubChem CID 23165405) has the molecular formula C12H9FN2O6 and a molecular weight of 296.21 g/mol. Its IUPAC name is (6-fluoro-2',5'-dioxospiro[2,3-dihydrochromene-4,4'-imidazolidine]-2-yl) hydrogen carbonate.
| Compound Name | (6-fluoro-2',5'-dioxospiro[2,3-dihydrochromene-4,4'-imidazolidine]-2-yl) hydrogen carbonate |
|---|---|
| PubChem CID | 23165405 |
| Molecular Formula | C12H9FN2O6 |
| Molecular Weight | 296.21 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | (6-fluoro-2',5'-dioxospiro[2,3-dihydrochromene-4,4'-imidazolidine]-2-yl) hydrogen carbonate |
| SMILES | O=C1NC(=O)C2(CC(OC(=O)O)Oc3ccc(F)cc32)N1 |
| InChI | InChI=1S/C12H9FN2O6/c13-5-1-2-7-6(3-5)12(9(16)14-10(17)15-12)4-8(20-7)21-11(18)19/h1-3,8H,4H2,(H,18,19)(H2,14,15,16,17) |
| InChIKey | LCRCHKFSXLPHTJ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.21 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|