About 2-(4-chlorophenyl)-6,6,6-trifluoro-2-(pyrazin-2-ylmethyl)hexanenitrile
2-(4-chlorophenyl)-6,6,6-trifluoro-2-(pyrazin-2-ylmethyl)hexanenitrile (PubChem CID 23165528) has the molecular formula C17H15ClF3N3
and a molecular weight of 353.78 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-6,6,6-trifluoro-2-(pyrazin-2-ylmethyl)hexanenitrile.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)-6,6,6-trifluoro-2-(pyrazin-2-ylmethyl)hexanenitrile |
| PubChem CID | 23165528 |
| Molecular Formula | C17H15ClF3N3 |
| Molecular Weight | 353.78 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 2-(4-chlorophenyl)-6,6,6-trifluoro-2-(pyrazin-2-ylmethyl)hexanenitrile |
| SMILES | N#CC(CCCC(F)(F)F)(Cc1cnccn1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H15ClF3N3/c18-14-4-2-13(3-5-14)16(12-22,6-1-7-17(19,20)21)10-15-11-23-8-9-24-15/h2-5,8-9,11H,1,6-7,10H2 |
| InChIKey | MQBDNNUXVUSYEG-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.78 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-chlorophenyl)-6,6,6-trifluoro-2-(pyrazin-2-ylmethyl)hexanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)-6,6,6-trifluoro-2-(pyrazin-2-ylmethyl)hexanenitrile?
The IUPAC name of 2-(4-chlorophenyl)-6,6,6-trifluoro-2-(pyrazin-2-ylmethyl)hexanenitrile (CID 23165528) is 2-(4-chlorophenyl)-6,6,6-trifluoro-2-(pyrazin-2-ylmethyl)hexanenitrile.
What is the SMILES notation for 2-(4-chlorophenyl)-6,6,6-trifluoro-2-(pyrazin-2-ylmethyl)hexanenitrile?
The canonical SMILES for 2-(4-chlorophenyl)-6,6,6-trifluoro-2-(pyrazin-2-ylmethyl)hexanenitrile is N#CC(CCCC(F)(F)F)(Cc1cnccn1)c1ccc(Cl)cc1.
What is the InChIKey of 2-(4-chlorophenyl)-6,6,6-trifluoro-2-(pyrazin-2-ylmethyl)hexanenitrile?
The InChIKey is MQBDNNUXVUSYEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15ClF3N3/c18-14-4-2-13(3-5-14)16(12-22,6-1-7-17(19,20)21)10-15-11-23-8-9-24-15/h2-5,8-9,11H,1,6-7,10H2.
What are the key properties of 2-(4-chlorophenyl)-6,6,6-trifluoro-2-(pyrazin-2-ylmethyl)hexanenitrile?
2-(4-chlorophenyl)-6,6,6-trifluoro-2-(pyrazin-2-ylmethyl)hexanenitrile has a molecular weight of 353.78 g/mol, XLogP of 4.87, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)-6,6,6-trifluoro-2-(pyrazin-2-ylmethyl)hexanenitrile is sourced from PubChem (CID 23165528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).