About 3,4-dimethyl-2,3-dihydro-1-benzothiophene
3,4-dimethyl-2,3-dihydro-1-benzothiophene (PubChem CID 23165633) has the molecular formula C10H12S
and a molecular weight of 164.27 g/mol. Its IUPAC name is 3,4-dimethyl-2,3-dihydro-1-benzothiophene.
Molecular Properties
| Compound Name | 3,4-dimethyl-2,3-dihydro-1-benzothiophene |
| PubChem CID | 23165633 |
| Molecular Formula | C10H12S |
| Molecular Weight | 164.27 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | 3,4-dimethyl-2,3-dihydro-1-benzothiophene |
| SMILES | Cc1cccc2c1C(C)CS2 |
| InChI | InChI=1S/C10H12S/c1-7-4-3-5-9-10(7)8(2)6-11-9/h3-5,8H,6H2,1-2H3 |
| InChIKey | PTLFLUJXFMDSJO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.27 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,4-dimethyl-2,3-dihydro-1-benzothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-2,3-dihydro-1-benzothiophene?
The IUPAC name of 3,4-dimethyl-2,3-dihydro-1-benzothiophene (CID 23165633) is 3,4-dimethyl-2,3-dihydro-1-benzothiophene.
What is the SMILES notation for 3,4-dimethyl-2,3-dihydro-1-benzothiophene?
The canonical SMILES for 3,4-dimethyl-2,3-dihydro-1-benzothiophene is Cc1cccc2c1C(C)CS2.
What is the InChIKey of 3,4-dimethyl-2,3-dihydro-1-benzothiophene?
The InChIKey is PTLFLUJXFMDSJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12S/c1-7-4-3-5-9-10(7)8(2)6-11-9/h3-5,8H,6H2,1-2H3.
What are the key properties of 3,4-dimethyl-2,3-dihydro-1-benzothiophene?
3,4-dimethyl-2,3-dihydro-1-benzothiophene has a molecular weight of 164.27 g/mol, XLogP of 3.20, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-2,3-dihydro-1-benzothiophene is sourced from PubChem (CID 23165633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).