About guanidine;trihydrochloride
guanidine;trihydrochloride (PubChem CID 23165990) has the molecular formula CH8Cl3N3
and a molecular weight of 168.46 g/mol. Its IUPAC name is guanidine;trihydrochloride.
Molecular Properties
| Compound Name | guanidine;trihydrochloride |
| PubChem CID | 23165990 |
| Molecular Formula | CH8Cl3N3 |
| Molecular Weight | 168.46 g/mol |
| Exact Mass | 166.98 |
| IUPAC Name | guanidine;trihydrochloride |
| SMILES | Cl.Cl.Cl.[H]N=C(N)N |
| InChI | InChI=1S/CH5N3.3ClH/c2-1(3)4;;;/h(H5,2,3,4);3*1H |
| InChIKey | IDJMDIVMAOGVJW-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 75.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.46 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze guanidine;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of guanidine;trihydrochloride?
The IUPAC name of guanidine;trihydrochloride (CID 23165990) is guanidine;trihydrochloride.
What is the SMILES notation for guanidine;trihydrochloride?
The canonical SMILES for guanidine;trihydrochloride is Cl.Cl.Cl.[H]N=C(N)N.
What is the InChIKey of guanidine;trihydrochloride?
The InChIKey is IDJMDIVMAOGVJW-UHFFFAOYSA-N. The full InChI is InChI=1S/CH5N3.3ClH/c2-1(3)4;;;/h(H5,2,3,4);3*1H.
What are the key properties of guanidine;trihydrochloride?
guanidine;trihydrochloride has a molecular weight of 168.46 g/mol, XLogP of 0.10, 0 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for guanidine;trihydrochloride is sourced from PubChem (CID 23165990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).