C18H15N3O3 — CID 23166249
5-(4-methoxyphenyl)-2-phenacyl-1,2,4-triazin-3-one (PubChem CID 23166249) has the molecular formula C18H15N3O3 and a molecular weight of 321.34 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-2-phenacyl-1,2,4-triazin-3-one.
| Compound Name | 5-(4-methoxyphenyl)-2-phenacyl-1,2,4-triazin-3-one |
|---|---|
| PubChem CID | 23166249 |
| Molecular Formula | C18H15N3O3 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 5-(4-methoxyphenyl)-2-phenacyl-1,2,4-triazin-3-one |
| SMILES | COc1ccc(-c2cnn(CC(=O)c3ccccc3)c(=O)n2)cc1 |
| InChI | InChI=1S/C18H15N3O3/c1-24-15-9-7-13(8-10-15)16-11-19-21(18(23)20-16)12-17(22)14-5-3-2-4-6-14/h2-11H,12H2,1H3 |
| InChIKey | CCQWFCDDGHHNSK-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |