About trimethyl-(N,N,N'-trimethylcarbamimidoyl)azanium chloride
trimethyl-(N,N,N'-trimethylcarbamimidoyl)azanium chloride (PubChem CID 23166293) has the molecular formula C7H18ClN3
and a molecular weight of 179.69 g/mol. Its IUPAC name is trimethyl-(N,N,N'-trimethylcarbamimidoyl)azanium chloride.
Molecular Properties
| Compound Name | trimethyl-(N,N,N'-trimethylcarbamimidoyl)azanium chloride |
| PubChem CID | 23166293 |
| Molecular Formula | C7H18ClN3 |
| Molecular Weight | 179.69 g/mol |
| Exact Mass | 179.12 |
| IUPAC Name | trimethyl-(N,N,N'-trimethylcarbamimidoyl)azanium chloride |
| SMILES | C/N=C(\N(C)C)[N+](C)(C)C.[Cl-] |
| InChI | InChI=1S/C7H18N3.ClH/c1-8-7(9(2)3)10(4,5)6;/h1-6H3;1H/q+1;/p-1/b8-7+; |
| InChIKey | CEICIFKIZAWDRK-USRGLUTNSA-M |
| XLogP | -2.76 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.69 |
| LogP ≤ 5 | -2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-(N,N,N'-trimethylcarbamimidoyl)azanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-(N,N,N'-trimethylcarbamimidoyl)azanium chloride?
The IUPAC name of trimethyl-(N,N,N'-trimethylcarbamimidoyl)azanium chloride (CID 23166293) is trimethyl-(N,N,N'-trimethylcarbamimidoyl)azanium chloride.
What is the SMILES notation for trimethyl-(N,N,N'-trimethylcarbamimidoyl)azanium chloride?
The canonical SMILES for trimethyl-(N,N,N'-trimethylcarbamimidoyl)azanium chloride is C/N=C(\N(C)C)[N+](C)(C)C.[Cl-].
What is the InChIKey of trimethyl-(N,N,N'-trimethylcarbamimidoyl)azanium chloride?
The InChIKey is CEICIFKIZAWDRK-USRGLUTNSA-M. The full InChI is InChI=1S/C7H18N3.ClH/c1-8-7(9(2)3)10(4,5)6;/h1-6H3;1H/q+1;/p-1/b8-7+;.
What are the key properties of trimethyl-(N,N,N'-trimethylcarbamimidoyl)azanium chloride?
trimethyl-(N,N,N'-trimethylcarbamimidoyl)azanium chloride has a molecular weight of 179.69 g/mol, XLogP of -2.76, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-(N,N,N'-trimethylcarbamimidoyl)azanium chloride is sourced from PubChem (CID 23166293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).