C18H19N5S2 — CID 2316664
(2Z)-2-(3-ethyl-4-thiophen-2-yl-1,3-thiazol-2-ylidene)-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)acetonitrile (PubChem CID 2316664) has the molecular formula C18H19N5S2 and a molecular weight of 369.52 g/mol. Its IUPAC name is (2Z)-2-(3-ethyl-4-thiophen-2-yl-1,3-thiazol-2-ylidene)-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)acetonitrile.
| Compound Name | (2Z)-2-(3-ethyl-4-thiophen-2-yl-1,3-thiazol-2-ylidene)-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)acetonitrile |
|---|---|
| PubChem CID | 2316664 |
| Molecular Formula | C18H19N5S2 |
| Molecular Weight | 369.52 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | (2Z)-2-(3-ethyl-4-thiophen-2-yl-1,3-thiazol-2-ylidene)-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)acetonitrile |
| SMILES | CCN1C(c2cccs2)=CS/C1=C(/C#N)c1nnc2n1CCCCC2 |
| InChI | InChI=1S/C18H19N5S2/c1-2-22-14(15-7-6-10-24-15)12-25-18(22)13(11-19)17-21-20-16-8-4-3-5-9-23(16)17/h6-7,10,12H,2-5,8-9H2,1H3/b18-13- |
| InChIKey | FJMJPYQDPVVTKP-AQTBWJFISA-N |
| XLogP | 4.33 |
| TPSA | 57.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.52 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|