About (2,5-dioxopyrrolidin-1-yl) 2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]acetate
(2,5-dioxopyrrolidin-1-yl) 2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]acetate (PubChem CID 23166843) has the molecular formula C13H13N3O7
and a molecular weight of 323.26 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]acetate.
Molecular Properties
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]acetate |
| PubChem CID | 23166843 |
| Molecular Formula | C13H13N3O7 |
| Molecular Weight | 323.26 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]acetate |
| SMILES | O=C(CCN1C(=O)C=CC1=O)NCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C13H13N3O7/c17-8(5-6-15-9(18)1-2-10(15)19)14-7-13(22)23-16-11(20)3-4-12(16)21/h1-2H,3-7H2,(H,14,17) |
| InChIKey | DBOCLTMMARJTQL-UHFFFAOYSA-N |
| XLogP | -1.98 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.26 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dioxopyrrolidin-1-yl) 2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dioxopyrrolidin-1-yl) 2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]acetate?
The IUPAC name of (2,5-dioxopyrrolidin-1-yl) 2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]acetate (CID 23166843) is (2,5-dioxopyrrolidin-1-yl) 2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]acetate.
What is the SMILES notation for (2,5-dioxopyrrolidin-1-yl) 2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]acetate?
The canonical SMILES for (2,5-dioxopyrrolidin-1-yl) 2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]acetate is O=C(CCN1C(=O)C=CC1=O)NCC(=O)ON1C(=O)CCC1=O.
What is the InChIKey of (2,5-dioxopyrrolidin-1-yl) 2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]acetate?
The InChIKey is DBOCLTMMARJTQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3O7/c17-8(5-6-15-9(18)1-2-10(15)19)14-7-13(22)23-16-11(20)3-4-12(16)21/h1-2H,3-7H2,(H,14,17).
What are the key properties of (2,5-dioxopyrrolidin-1-yl) 2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]acetate?
(2,5-dioxopyrrolidin-1-yl) 2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]acetate has a molecular weight of 323.26 g/mol, XLogP of -1.98, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dioxopyrrolidin-1-yl) 2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]acetate is sourced from PubChem (CID 23166843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).