C16H17NO5 — CID 23167499
methyl [2-oxo-6-(2-propoxyphenyl)-1H-pyridin-3-yl] carbonate (PubChem CID 23167499) has the molecular formula C16H17NO5 and a molecular weight of 303.31 g/mol. Its IUPAC name is methyl [2-oxo-6-(2-propoxyphenyl)-1H-pyridin-3-yl] carbonate.
| Compound Name | methyl [2-oxo-6-(2-propoxyphenyl)-1H-pyridin-3-yl] carbonate |
|---|---|
| PubChem CID | 23167499 |
| Molecular Formula | C16H17NO5 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | methyl [2-oxo-6-(2-propoxyphenyl)-1H-pyridin-3-yl] carbonate |
| SMILES | CCCOc1ccccc1-c1ccc(OC(=O)OC)c(=O)[nH]1 |
| InChI | InChI=1S/C16H17NO5/c1-3-10-21-13-7-5-4-6-11(13)12-8-9-14(15(18)17-12)22-16(19)20-2/h4-9H,3,10H2,1-2H3,(H,17,18) |
| InChIKey | RIXTVTRGUQTUPB-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 77.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |