C13H26O2 — CID 23167511
1-(3-methyl-2-propan-2-ylcyclohexyl)propane-1,3-diol (PubChem CID 23167511) has the molecular formula C13H26O2 and a molecular weight of 214.35 g/mol. Its IUPAC name is 1-(3-methyl-2-propan-2-ylcyclohexyl)propane-1,3-diol.
| Compound Name | 1-(3-methyl-2-propan-2-ylcyclohexyl)propane-1,3-diol |
|---|---|
| PubChem CID | 23167511 |
| Molecular Formula | C13H26O2 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.19 |
| IUPAC Name | 1-(3-methyl-2-propan-2-ylcyclohexyl)propane-1,3-diol |
| SMILES | CC(C)C1C(C)CCCC1C(O)CCO |
| InChI | InChI=1S/C13H26O2/c1-9(2)13-10(3)5-4-6-11(13)12(15)7-8-14/h9-15H,4-8H2,1-3H3 |
| InChIKey | BMDJDWRUNNLWNV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |