About propan-2-yl (E)-3-(2,2-dimethylcyclopropyl)-2-fluoroprop-2-enoate
propan-2-yl (E)-3-(2,2-dimethylcyclopropyl)-2-fluoroprop-2-enoate (PubChem CID 23168327) has the molecular formula C11H17FO2
and a molecular weight of 200.25 g/mol. Its IUPAC name is propan-2-yl (E)-3-(2,2-dimethylcyclopropyl)-2-fluoroprop-2-enoate.
Molecular Properties
| Compound Name | propan-2-yl (E)-3-(2,2-dimethylcyclopropyl)-2-fluoroprop-2-enoate |
| PubChem CID | 23168327 |
| Molecular Formula | C11H17FO2 |
| Molecular Weight | 200.25 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | propan-2-yl (E)-3-(2,2-dimethylcyclopropyl)-2-fluoroprop-2-enoate |
| SMILES | CC(C)OC(=O)/C(F)=C\C1CC1(C)C |
| InChI | InChI=1S/C11H17FO2/c1-7(2)14-10(13)9(12)5-8-6-11(8,3)4/h5,7-8H,6H2,1-4H3/b9-5+ |
| InChIKey | LRNXQVGLSJAAFU-WEVVVXLNSA-N |
| XLogP | 2.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.25 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl (E)-3-(2,2-dimethylcyclopropyl)-2-fluoroprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl (E)-3-(2,2-dimethylcyclopropyl)-2-fluoroprop-2-enoate?
The IUPAC name of propan-2-yl (E)-3-(2,2-dimethylcyclopropyl)-2-fluoroprop-2-enoate (CID 23168327) is propan-2-yl (E)-3-(2,2-dimethylcyclopropyl)-2-fluoroprop-2-enoate.
What is the SMILES notation for propan-2-yl (E)-3-(2,2-dimethylcyclopropyl)-2-fluoroprop-2-enoate?
The canonical SMILES for propan-2-yl (E)-3-(2,2-dimethylcyclopropyl)-2-fluoroprop-2-enoate is CC(C)OC(=O)/C(F)=C\C1CC1(C)C.
What is the InChIKey of propan-2-yl (E)-3-(2,2-dimethylcyclopropyl)-2-fluoroprop-2-enoate?
The InChIKey is LRNXQVGLSJAAFU-WEVVVXLNSA-N. The full InChI is InChI=1S/C11H17FO2/c1-7(2)14-10(13)9(12)5-8-6-11(8,3)4/h5,7-8H,6H2,1-4H3/b9-5+.
What are the key properties of propan-2-yl (E)-3-(2,2-dimethylcyclopropyl)-2-fluoroprop-2-enoate?
propan-2-yl (E)-3-(2,2-dimethylcyclopropyl)-2-fluoroprop-2-enoate has a molecular weight of 200.25 g/mol, XLogP of 2.84, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl (E)-3-(2,2-dimethylcyclopropyl)-2-fluoroprop-2-enoate is sourced from PubChem (CID 23168327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).