C16H23BrN4 — CID 23169392
2-N,4-N,1,6-tetramethyl-4-N-(2-phenylethyl)pyrimidin-1-ium-2,4-diamine bromide (PubChem CID 23169392) has the molecular formula C16H23BrN4 and a molecular weight of 351.29 g/mol. Its IUPAC name is 2-N,4-N,1,6-tetramethyl-4-N-(2-phenylethyl)pyrimidin-1-ium-2,4-diamine bromide.
| Compound Name | 2-N,4-N,1,6-tetramethyl-4-N-(2-phenylethyl)pyrimidin-1-ium-2,4-diamine bromide |
|---|---|
| PubChem CID | 23169392 |
| Molecular Formula | C16H23BrN4 |
| Molecular Weight | 351.29 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 2-N,4-N,1,6-tetramethyl-4-N-(2-phenylethyl)pyrimidin-1-ium-2,4-diamine bromide |
| SMILES | CNc1nc(N(C)CCc2ccccc2)cc(C)[n+]1C.[Br-] |
| InChI | InChI=1S/C16H22N4.BrH/c1-13-12-15(18-16(17-2)20(13)4)19(3)11-10-14-8-6-5-7-9-14;/h5-9,12H,10-11H2,1-4H3;1H |
| InChIKey | HGUCBEPLKVWGCW-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 32.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.29 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|