About 1-(prop-2-enoylamino)ethyl prop-2-ynyl carbonate
1-(prop-2-enoylamino)ethyl prop-2-ynyl carbonate (PubChem CID 23169804) has the molecular formula C9H11NO4
and a molecular weight of 197.19 g/mol. Its IUPAC name is 1-(prop-2-enoylamino)ethyl prop-2-ynyl carbonate.
Molecular Properties
| Compound Name | 1-(prop-2-enoylamino)ethyl prop-2-ynyl carbonate |
| PubChem CID | 23169804 |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 1-(prop-2-enoylamino)ethyl prop-2-ynyl carbonate |
| SMILES | C#CCOC(=O)OC(C)NC(=O)C=C |
| InChI | InChI=1S/C9H11NO4/c1-4-6-13-9(12)14-7(3)10-8(11)5-2/h1,5,7H,2,6H2,3H3,(H,10,11) |
| InChIKey | UVOABCSDGPEDHR-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(prop-2-enoylamino)ethyl prop-2-ynyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(prop-2-enoylamino)ethyl prop-2-ynyl carbonate?
The IUPAC name of 1-(prop-2-enoylamino)ethyl prop-2-ynyl carbonate (CID 23169804) is 1-(prop-2-enoylamino)ethyl prop-2-ynyl carbonate.
What is the SMILES notation for 1-(prop-2-enoylamino)ethyl prop-2-ynyl carbonate?
The canonical SMILES for 1-(prop-2-enoylamino)ethyl prop-2-ynyl carbonate is C#CCOC(=O)OC(C)NC(=O)C=C.
What is the InChIKey of 1-(prop-2-enoylamino)ethyl prop-2-ynyl carbonate?
The InChIKey is UVOABCSDGPEDHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO4/c1-4-6-13-9(12)14-7(3)10-8(11)5-2/h1,5,7H,2,6H2,3H3,(H,10,11).
What are the key properties of 1-(prop-2-enoylamino)ethyl prop-2-ynyl carbonate?
1-(prop-2-enoylamino)ethyl prop-2-ynyl carbonate has a molecular weight of 197.19 g/mol, XLogP of 0.42, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(prop-2-enoylamino)ethyl prop-2-ynyl carbonate is sourced from PubChem (CID 23169804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).