About (3-phenylcyclohexa-1,5-dien-1-yl)benzene
(3-phenylcyclohexa-1,5-dien-1-yl)benzene (PubChem CID 23170334) has the molecular formula C18H16
and a molecular weight of 232.33 g/mol. Its IUPAC name is (3-phenylcyclohexa-1,5-dien-1-yl)benzene.
Molecular Properties
| Compound Name | (3-phenylcyclohexa-1,5-dien-1-yl)benzene |
| PubChem CID | 23170334 |
| Molecular Formula | C18H16 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | (3-phenylcyclohexa-1,5-dien-1-yl)benzene |
| SMILES | C1=CC(c2ccccc2)=CC(c2ccccc2)C1 |
| InChI | InChI=1S/C18H16/c1-3-8-15(9-4-1)17-12-7-13-18(14-17)16-10-5-2-6-11-16/h1-12,14,18H,13H2 |
| InChIKey | QZUGTKGGYAVJQP-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (3-phenylcyclohexa-1,5-dien-1-yl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-phenylcyclohexa-1,5-dien-1-yl)benzene?
The IUPAC name of (3-phenylcyclohexa-1,5-dien-1-yl)benzene (CID 23170334) is (3-phenylcyclohexa-1,5-dien-1-yl)benzene.
What is the SMILES notation for (3-phenylcyclohexa-1,5-dien-1-yl)benzene?
The canonical SMILES for (3-phenylcyclohexa-1,5-dien-1-yl)benzene is C1=CC(c2ccccc2)=CC(c2ccccc2)C1.
What is the InChIKey of (3-phenylcyclohexa-1,5-dien-1-yl)benzene?
The InChIKey is QZUGTKGGYAVJQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16/c1-3-8-15(9-4-1)17-12-7-13-18(14-17)16-10-5-2-6-11-16/h1-12,14,18H,13H2.
What are the key properties of (3-phenylcyclohexa-1,5-dien-1-yl)benzene?
(3-phenylcyclohexa-1,5-dien-1-yl)benzene has a molecular weight of 232.33 g/mol, XLogP of 4.81, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3-phenylcyclohexa-1,5-dien-1-yl)benzene is sourced from PubChem (CID 23170334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).