C23H25NO3 — CID 23170694
[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1H-indol-6-yl] hydrogen carbonate (PubChem CID 23170694) has the molecular formula C23H25NO3 and a molecular weight of 363.46 g/mol. Its IUPAC name is [2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1H-indol-6-yl] hydrogen carbonate.
| Compound Name | [2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1H-indol-6-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 23170694 |
| Molecular Formula | C23H25NO3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | [2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1H-indol-6-yl] hydrogen carbonate |
| SMILES | CC1(C)CCC(C)(C)c2cc(-c3cc4ccc(OC(=O)O)cc4[nH]3)ccc21 |
| InChI | InChI=1S/C23H25NO3/c1-22(2)9-10-23(3,4)18-11-14(6-8-17(18)22)19-12-15-5-7-16(27-21(25)26)13-20(15)24-19/h5-8,11-13,24H,9-10H2,1-4H3,(H,25,26) |
| InChIKey | AOEPJFHYZRHWPG-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|