About 5-hexyl-3,4-bis(8-isocyanatooctyl)-4-octylcyclohexene
5-hexyl-3,4-bis(8-isocyanatooctyl)-4-octylcyclohexene (PubChem CID 23170973) has the molecular formula C38H68N2O2
and a molecular weight of 584.97 g/mol. Its IUPAC name is 5-hexyl-3,4-bis(8-isocyanatooctyl)-4-octylcyclohexene.
Molecular Properties
| Compound Name | 5-hexyl-3,4-bis(8-isocyanatooctyl)-4-octylcyclohexene |
| PubChem CID | 23170973 |
| Molecular Formula | C38H68N2O2 |
| Molecular Weight | 584.97 g/mol |
| Exact Mass | 584.53 |
| IUPAC Name | 5-hexyl-3,4-bis(8-isocyanatooctyl)-4-octylcyclohexene |
| SMILES | CCCCCCCCC1(CCCCCCCCN=C=O)C(CCCCCCCCN=C=O)C=CCC1CCCCCC |
| InChI | InChI=1S/C38H68N2O2/c1-3-5-7-9-15-21-30-38(31-22-16-11-13-18-24-33-40-35-42)36(26-19-8-6-4-2)28-25-29-37(38)27-20-14-10-12-17-23-32-39-34-41/h25,29,36-37H,3-24,26-28,30-33H2,1-2H3 |
| InChIKey | IOJPZUCHKKTLDX-UHFFFAOYSA-N |
| XLogP | 12.02 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 584.97 |
| LogP ≤ 5 | 12.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-hexyl-3,4-bis(8-isocyanatooctyl)-4-octylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hexyl-3,4-bis(8-isocyanatooctyl)-4-octylcyclohexene?
The IUPAC name of 5-hexyl-3,4-bis(8-isocyanatooctyl)-4-octylcyclohexene (CID 23170973) is 5-hexyl-3,4-bis(8-isocyanatooctyl)-4-octylcyclohexene.
What is the SMILES notation for 5-hexyl-3,4-bis(8-isocyanatooctyl)-4-octylcyclohexene?
The canonical SMILES for 5-hexyl-3,4-bis(8-isocyanatooctyl)-4-octylcyclohexene is CCCCCCCCC1(CCCCCCCCN=C=O)C(CCCCCCCCN=C=O)C=CCC1CCCCCC.
What is the InChIKey of 5-hexyl-3,4-bis(8-isocyanatooctyl)-4-octylcyclohexene?
The InChIKey is IOJPZUCHKKTLDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C38H68N2O2/c1-3-5-7-9-15-21-30-38(31-22-16-11-13-18-24-33-40-35-42)36(26-19-8-6-4-2)28-25-29-37(38)27-20-14-10-12-17-23-32-39-34-41/h25,29,36-37H,3-24,26-28,30-33H2,1-2H3.
What are the key properties of 5-hexyl-3,4-bis(8-isocyanatooctyl)-4-octylcyclohexene?
5-hexyl-3,4-bis(8-isocyanatooctyl)-4-octylcyclohexene has a molecular weight of 584.97 g/mol, XLogP of 12.02, 30 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hexyl-3,4-bis(8-isocyanatooctyl)-4-octylcyclohexene is sourced from PubChem (CID 23170973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).