About (2-oxospiro[1H-indole-3,1'-cyclopropane]-6-yl) hydrogen carbonate
(2-oxospiro[1H-indole-3,1'-cyclopropane]-6-yl) hydrogen carbonate (PubChem CID 23171245) has the molecular formula C11H9NO4
and a molecular weight of 219.20 g/mol. Its IUPAC name is (2-oxospiro[1H-indole-3,1'-cyclopropane]-6-yl) hydrogen carbonate.
Molecular Properties
| Compound Name | (2-oxospiro[1H-indole-3,1'-cyclopropane]-6-yl) hydrogen carbonate |
| PubChem CID | 23171245 |
| Molecular Formula | C11H9NO4 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | (2-oxospiro[1H-indole-3,1'-cyclopropane]-6-yl) hydrogen carbonate |
| SMILES | O=C(O)Oc1ccc2c(c1)NC(=O)C21CC1 |
| InChI | InChI=1S/C11H9NO4/c13-9-11(3-4-11)7-2-1-6(16-10(14)15)5-8(7)12-9/h1-2,5H,3-4H2,(H,12,13)(H,14,15) |
| InChIKey | RRZXBXMXYHMDQI-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze (2-oxospiro[1H-indole-3,1'-cyclopropane]-6-yl) hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxospiro[1H-indole-3,1'-cyclopropane]-6-yl) hydrogen carbonate?
The IUPAC name of (2-oxospiro[1H-indole-3,1'-cyclopropane]-6-yl) hydrogen carbonate (CID 23171245) is (2-oxospiro[1H-indole-3,1'-cyclopropane]-6-yl) hydrogen carbonate.
What is the SMILES notation for (2-oxospiro[1H-indole-3,1'-cyclopropane]-6-yl) hydrogen carbonate?
The canonical SMILES for (2-oxospiro[1H-indole-3,1'-cyclopropane]-6-yl) hydrogen carbonate is O=C(O)Oc1ccc2c(c1)NC(=O)C21CC1.
What is the InChIKey of (2-oxospiro[1H-indole-3,1'-cyclopropane]-6-yl) hydrogen carbonate?
The InChIKey is RRZXBXMXYHMDQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO4/c13-9-11(3-4-11)7-2-1-6(16-10(14)15)5-8(7)12-9/h1-2,5H,3-4H2,(H,12,13)(H,14,15).
What are the key properties of (2-oxospiro[1H-indole-3,1'-cyclopropane]-6-yl) hydrogen carbonate?
(2-oxospiro[1H-indole-3,1'-cyclopropane]-6-yl) hydrogen carbonate has a molecular weight of 219.20 g/mol, XLogP of 1.73, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxospiro[1H-indole-3,1'-cyclopropane]-6-yl) hydrogen carbonate is sourced from PubChem (CID 23171245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).