About (1-methylpiperidin-4-yl) N-(3-hydroxypropyl)carbamate
(1-methylpiperidin-4-yl) N-(3-hydroxypropyl)carbamate (PubChem CID 23171364) has the molecular formula C10H20N2O3
and a molecular weight of 216.28 g/mol. Its IUPAC name is (1-methylpiperidin-4-yl) N-(3-hydroxypropyl)carbamate.
Molecular Properties
| Compound Name | (1-methylpiperidin-4-yl) N-(3-hydroxypropyl)carbamate |
| PubChem CID | 23171364 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | (1-methylpiperidin-4-yl) N-(3-hydroxypropyl)carbamate |
| SMILES | CN1CCC(OC(=O)NCCCO)CC1 |
| InChI | InChI=1S/C10H20N2O3/c1-12-6-3-9(4-7-12)15-10(14)11-5-2-8-13/h9,13H,2-8H2,1H3,(H,11,14) |
| InChIKey | CZZDKIUGTBGJHJ-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (1-methylpiperidin-4-yl) N-(3-hydroxypropyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylpiperidin-4-yl) N-(3-hydroxypropyl)carbamate?
The IUPAC name of (1-methylpiperidin-4-yl) N-(3-hydroxypropyl)carbamate (CID 23171364) is (1-methylpiperidin-4-yl) N-(3-hydroxypropyl)carbamate.
What is the SMILES notation for (1-methylpiperidin-4-yl) N-(3-hydroxypropyl)carbamate?
The canonical SMILES for (1-methylpiperidin-4-yl) N-(3-hydroxypropyl)carbamate is CN1CCC(OC(=O)NCCCO)CC1.
What is the InChIKey of (1-methylpiperidin-4-yl) N-(3-hydroxypropyl)carbamate?
The InChIKey is CZZDKIUGTBGJHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O3/c1-12-6-3-9(4-7-12)15-10(14)11-5-2-8-13/h9,13H,2-8H2,1H3,(H,11,14).
What are the key properties of (1-methylpiperidin-4-yl) N-(3-hydroxypropyl)carbamate?
(1-methylpiperidin-4-yl) N-(3-hydroxypropyl)carbamate has a molecular weight of 216.28 g/mol, XLogP of 0.19, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylpiperidin-4-yl) N-(3-hydroxypropyl)carbamate is sourced from PubChem (CID 23171364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).