About (4-cyclohexyl-1-propylcyclohexyl) (4-fluorophenyl) carbonate
(4-cyclohexyl-1-propylcyclohexyl) (4-fluorophenyl) carbonate (PubChem CID 23171371) has the molecular formula C22H31FO3
and a molecular weight of 362.49 g/mol. Its IUPAC name is (4-cyclohexyl-1-propylcyclohexyl) (4-fluorophenyl) carbonate.
Molecular Properties
| Compound Name | (4-cyclohexyl-1-propylcyclohexyl) (4-fluorophenyl) carbonate |
| PubChem CID | 23171371 |
| Molecular Formula | C22H31FO3 |
| Molecular Weight | 362.49 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | (4-cyclohexyl-1-propylcyclohexyl) (4-fluorophenyl) carbonate |
| SMILES | CCCC1(OC(=O)Oc2ccc(F)cc2)CCC(C2CCCCC2)CC1 |
| InChI | InChI=1S/C22H31FO3/c1-2-14-22(26-21(24)25-20-10-8-19(23)9-11-20)15-12-18(13-16-22)17-6-4-3-5-7-17/h8-11,17-18H,2-7,12-16H2,1H3 |
| InChIKey | JZMYFIZZJIWUSM-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.49 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze (4-cyclohexyl-1-propylcyclohexyl) (4-fluorophenyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyclohexyl-1-propylcyclohexyl) (4-fluorophenyl) carbonate?
The IUPAC name of (4-cyclohexyl-1-propylcyclohexyl) (4-fluorophenyl) carbonate (CID 23171371) is (4-cyclohexyl-1-propylcyclohexyl) (4-fluorophenyl) carbonate.
What is the SMILES notation for (4-cyclohexyl-1-propylcyclohexyl) (4-fluorophenyl) carbonate?
The canonical SMILES for (4-cyclohexyl-1-propylcyclohexyl) (4-fluorophenyl) carbonate is CCCC1(OC(=O)Oc2ccc(F)cc2)CCC(C2CCCCC2)CC1.
What is the InChIKey of (4-cyclohexyl-1-propylcyclohexyl) (4-fluorophenyl) carbonate?
The InChIKey is JZMYFIZZJIWUSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H31FO3/c1-2-14-22(26-21(24)25-20-10-8-19(23)9-11-20)15-12-18(13-16-22)17-6-4-3-5-7-17/h8-11,17-18H,2-7,12-16H2,1H3.
What are the key properties of (4-cyclohexyl-1-propylcyclohexyl) (4-fluorophenyl) carbonate?
(4-cyclohexyl-1-propylcyclohexyl) (4-fluorophenyl) carbonate has a molecular weight of 362.49 g/mol, XLogP of 6.65, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyclohexyl-1-propylcyclohexyl) (4-fluorophenyl) carbonate is sourced from PubChem (CID 23171371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).