C25H22N4O2 — CID 23171559
1-[2-(aminomethyl)-2,3-dihydro-1H-pyrrolo[1,2-a]indol-4-yl]-3-(1-methylindol-3-yl)pyrrole-2,5-dione (PubChem CID 23171559) has the molecular formula C25H22N4O2 and a molecular weight of 410.48 g/mol. Its IUPAC name is 1-[2-(aminomethyl)-2,3-dihydro-1H-pyrrolo[1,2-a]indol-4-yl]-3-(1-methylindol-3-yl)pyrrole-2,5-dione.
| Compound Name | 1-[2-(aminomethyl)-2,3-dihydro-1H-pyrrolo[1,2-a]indol-4-yl]-3-(1-methylindol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 23171559 |
| Molecular Formula | C25H22N4O2 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 1-[2-(aminomethyl)-2,3-dihydro-1H-pyrrolo[1,2-a]indol-4-yl]-3-(1-methylindol-3-yl)pyrrole-2,5-dione |
| SMILES | Cn1cc(C2=CC(=O)N(c3c4n(c5ccccc35)CC(CN)C4)C2=O)c2ccccc21 |
| InChI | InChI=1S/C25H22N4O2/c1-27-14-19(16-6-2-4-8-20(16)27)18-11-23(30)29(25(18)31)24-17-7-3-5-9-21(17)28-13-15(12-26)10-22(24)28/h2-9,11,14-15H,10,12-13,26H2,1H3 |
| InChIKey | KWTIOGQTZVSLGD-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 73.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|