About 4,4-bis(methoxymethyl)-2,6-dimethylheptane;ethoxyethane
4,4-bis(methoxymethyl)-2,6-dimethylheptane;ethoxyethane (PubChem CID 23173092) has the molecular formula C17H38O3
and a molecular weight of 290.49 g/mol. Its IUPAC name is 4,4-bis(methoxymethyl)-2,6-dimethylheptane;ethoxyethane.
Molecular Properties
| Compound Name | 4,4-bis(methoxymethyl)-2,6-dimethylheptane;ethoxyethane |
| PubChem CID | 23173092 |
| Molecular Formula | C17H38O3 |
| Molecular Weight | 290.49 g/mol |
| Exact Mass | 290.28 |
| IUPAC Name | 4,4-bis(methoxymethyl)-2,6-dimethylheptane;ethoxyethane |
| SMILES | CCOCC.COCC(COC)(CC(C)C)CC(C)C |
| InChI | InChI=1S/C13H28O2.C4H10O/c1-11(2)7-13(9-14-5,10-15-6)8-12(3)4;1-3-5-4-2/h11-12H,7-10H2,1-6H3;3-4H2,1-2H3 |
| InChIKey | AHAFGGGJTDGBAB-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.49 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,4-bis(methoxymethyl)-2,6-dimethylheptane;ethoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-bis(methoxymethyl)-2,6-dimethylheptane;ethoxyethane?
The IUPAC name of 4,4-bis(methoxymethyl)-2,6-dimethylheptane;ethoxyethane (CID 23173092) is 4,4-bis(methoxymethyl)-2,6-dimethylheptane;ethoxyethane.
What is the SMILES notation for 4,4-bis(methoxymethyl)-2,6-dimethylheptane;ethoxyethane?
The canonical SMILES for 4,4-bis(methoxymethyl)-2,6-dimethylheptane;ethoxyethane is CCOCC.COCC(COC)(CC(C)C)CC(C)C.
What is the InChIKey of 4,4-bis(methoxymethyl)-2,6-dimethylheptane;ethoxyethane?
The InChIKey is AHAFGGGJTDGBAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28O2.C4H10O/c1-11(2)7-13(9-14-5,10-15-6)8-12(3)4;1-3-5-4-2/h11-12H,7-10H2,1-6H3;3-4H2,1-2H3.
What are the key properties of 4,4-bis(methoxymethyl)-2,6-dimethylheptane;ethoxyethane?
4,4-bis(methoxymethyl)-2,6-dimethylheptane;ethoxyethane has a molecular weight of 290.49 g/mol, XLogP of 4.40, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-bis(methoxymethyl)-2,6-dimethylheptane;ethoxyethane is sourced from PubChem (CID 23173092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).