C19H19N5S2 — CID 2317360
(2E)-2-(3-prop-2-enyl-4-thiophen-2-yl-1,3-thiazol-2-ylidene)-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)acetonitrile (PubChem CID 2317360) has the molecular formula C19H19N5S2 and a molecular weight of 381.53 g/mol. Its IUPAC name is (2E)-2-(3-prop-2-enyl-4-thiophen-2-yl-1,3-thiazol-2-ylidene)-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)acetonitrile.
| Compound Name | (2E)-2-(3-prop-2-enyl-4-thiophen-2-yl-1,3-thiazol-2-ylidene)-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)acetonitrile |
|---|---|
| PubChem CID | 2317360 |
| Molecular Formula | C19H19N5S2 |
| Molecular Weight | 381.53 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | (2E)-2-(3-prop-2-enyl-4-thiophen-2-yl-1,3-thiazol-2-ylidene)-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)acetonitrile |
| SMILES | C=CCN1C(c2cccs2)=CS/C1=C(\C#N)c1nnc2n1CCCCC2 |
| InChI | InChI=1S/C19H19N5S2/c1-2-9-23-15(16-7-6-11-25-16)13-26-19(23)14(12-20)18-22-21-17-8-4-3-5-10-24(17)18/h2,6-7,11,13H,1,3-5,8-10H2/b19-14+ |
| InChIKey | TWJYSRDEWKFXGT-XMHGGMMESA-N |
| XLogP | 4.49 |
| TPSA | 57.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.53 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|