C15H29N2O2+ — CID 23174118
N-(1-acetyl-2,2,6,6-tetramethyl-1-propylpiperidin-1-ium-4-yl)methanimine oxide (PubChem CID 23174118) has the molecular formula C15H29N2O2+ and a molecular weight of 269.41 g/mol. Its IUPAC name is N-(1-acetyl-2,2,6,6-tetramethyl-1-propylpiperidin-1-ium-4-yl)methanimine oxide.
| Compound Name | N-(1-acetyl-2,2,6,6-tetramethyl-1-propylpiperidin-1-ium-4-yl)methanimine oxide |
|---|---|
| PubChem CID | 23174118 |
| Molecular Formula | C15H29N2O2+ |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.22 |
| IUPAC Name | N-(1-acetyl-2,2,6,6-tetramethyl-1-propylpiperidin-1-ium-4-yl)methanimine oxide |
| SMILES | C=[N+]([O-])C1CC(C)(C)[N+](CCC)(C(C)=O)C(C)(C)C1 |
| InChI | InChI=1S/C15H29N2O2/c1-8-9-17(12(2)18)14(3,4)10-13(16(7)19)11-15(17,5)6/h13H,7-11H2,1-6H3/q+1 |
| InChIKey | MIDDTAWIQDWOJE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|