C20H38O13P2 — CID 23174163
[1-[bis(2,2-dimethylpropanoyloxymethoxy)phosphoryl]-1-hydroxyethyl]-(2,2-dimethylpropanoyloxymethoxy)phosphinic acid (PubChem CID 23174163) has the molecular formula C20H38O13P2 and a molecular weight of 548.46 g/mol. Its IUPAC name is [1-[bis(2,2-dimethylpropanoyloxymethoxy)phosphoryl]-1-hydroxyethyl]-(2,2-dimethylpropanoyloxymethoxy)phosphinic acid.
| Compound Name | [1-[bis(2,2-dimethylpropanoyloxymethoxy)phosphoryl]-1-hydroxyethyl]-(2,2-dimethylpropanoyloxymethoxy)phosphinic acid |
|---|---|
| PubChem CID | 23174163 |
| Molecular Formula | C20H38O13P2 |
| Molecular Weight | 548.46 g/mol |
| Exact Mass | 548.18 |
| IUPAC Name | [1-[bis(2,2-dimethylpropanoyloxymethoxy)phosphoryl]-1-hydroxyethyl]-(2,2-dimethylpropanoyloxymethoxy)phosphinic acid |
| SMILES | CC(C)(C)C(=O)OCOP(=O)(O)C(C)(O)P(=O)(OCOC(=O)C(C)(C)C)OCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C20H38O13P2/c1-17(2,3)14(21)28-11-31-34(25,26)20(10,24)35(27,32-12-29-15(22)18(4,5)6)33-13-30-16(23)19(7,8)9/h24H,11-13H2,1-10H3,(H,25,26) |
| InChIKey | MNYSFTVIKLHILG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 181.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.46 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|