C24H28N2O3 — CID 23174294
[6-[2-(2,2,4,4,7-pentamethyl-3H-chromen-6-yl)ethynyl]pyridazin-3-yl] butanoate (PubChem CID 23174294) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is [6-[2-(2,2,4,4,7-pentamethyl-3H-chromen-6-yl)ethynyl]pyridazin-3-yl] butanoate.
| Compound Name | [6-[2-(2,2,4,4,7-pentamethyl-3H-chromen-6-yl)ethynyl]pyridazin-3-yl] butanoate |
|---|---|
| PubChem CID | 23174294 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | [6-[2-(2,2,4,4,7-pentamethyl-3H-chromen-6-yl)ethynyl]pyridazin-3-yl] butanoate |
| SMILES | CCCC(=O)Oc1ccc(C#Cc2cc3c(cc2C)OC(C)(C)CC3(C)C)nn1 |
| InChI | InChI=1S/C24H28N2O3/c1-7-8-22(27)28-21-12-11-18(25-26-21)10-9-17-14-19-20(13-16(17)2)29-24(5,6)15-23(19,3)4/h11-14H,7-8,15H2,1-6H3 |
| InChIKey | QADLEKKBDDDJHV-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|