About 2-(3,3-dimethyl-5-piperidin-1-ium-1-ylidenecyclohexen-1-yl)-1,1-dimethylhydrazine
2-(3,3-dimethyl-5-piperidin-1-ium-1-ylidenecyclohexen-1-yl)-1,1-dimethylhydrazine (PubChem CID 2317439) has the molecular formula C15H28N3+
and a molecular weight of 250.41 g/mol. Its IUPAC name is 2-(3,3-dimethyl-5-piperidin-1-ium-1-ylidenecyclohexen-1-yl)-1,1-dimethylhydrazine.
Molecular Properties
| Compound Name | 2-(3,3-dimethyl-5-piperidin-1-ium-1-ylidenecyclohexen-1-yl)-1,1-dimethylhydrazine |
| PubChem CID | 2317439 |
| Molecular Formula | C15H28N3+ |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.23 |
| IUPAC Name | 2-(3,3-dimethyl-5-piperidin-1-ium-1-ylidenecyclohexen-1-yl)-1,1-dimethylhydrazine |
| SMILES | CN(C)NC1=CC(C)(C)CC(=[N+]2CCCCC2)C1 |
| InChI | InChI=1S/C15H28N3/c1-15(2)11-13(16-17(3)4)10-14(12-15)18-8-6-5-7-9-18/h11,16H,5-10,12H2,1-4H3/q+1 |
| InChIKey | UQQVLVCYZNJHJZ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 18.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,3-dimethyl-5-piperidin-1-ium-1-ylidenecyclohexen-1-yl)-1,1-dimethylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,3-dimethyl-5-piperidin-1-ium-1-ylidenecyclohexen-1-yl)-1,1-dimethylhydrazine?
The IUPAC name of 2-(3,3-dimethyl-5-piperidin-1-ium-1-ylidenecyclohexen-1-yl)-1,1-dimethylhydrazine (CID 2317439) is 2-(3,3-dimethyl-5-piperidin-1-ium-1-ylidenecyclohexen-1-yl)-1,1-dimethylhydrazine.
What is the SMILES notation for 2-(3,3-dimethyl-5-piperidin-1-ium-1-ylidenecyclohexen-1-yl)-1,1-dimethylhydrazine?
The canonical SMILES for 2-(3,3-dimethyl-5-piperidin-1-ium-1-ylidenecyclohexen-1-yl)-1,1-dimethylhydrazine is CN(C)NC1=CC(C)(C)CC(=[N+]2CCCCC2)C1.
What is the InChIKey of 2-(3,3-dimethyl-5-piperidin-1-ium-1-ylidenecyclohexen-1-yl)-1,1-dimethylhydrazine?
The InChIKey is UQQVLVCYZNJHJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N3/c1-15(2)11-13(16-17(3)4)10-14(12-15)18-8-6-5-7-9-18/h11,16H,5-10,12H2,1-4H3/q+1.
What are the key properties of 2-(3,3-dimethyl-5-piperidin-1-ium-1-ylidenecyclohexen-1-yl)-1,1-dimethylhydrazine?
2-(3,3-dimethyl-5-piperidin-1-ium-1-ylidenecyclohexen-1-yl)-1,1-dimethylhydrazine has a molecular weight of 250.41 g/mol, XLogP of 2.39, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,3-dimethyl-5-piperidin-1-ium-1-ylidenecyclohexen-1-yl)-1,1-dimethylhydrazine is sourced from PubChem (CID 2317439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).