About propane-1,1-diol;propane-1,3-diol
propane-1,1-diol;propane-1,3-diol (PubChem CID 23174644) has the molecular formula C6H16O4
and a molecular weight of 152.19 g/mol. Its IUPAC name is propane-1,1-diol;propane-1,3-diol.
Molecular Properties
| Compound Name | propane-1,1-diol;propane-1,3-diol |
| PubChem CID | 23174644 |
| Molecular Formula | C6H16O4 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.10 |
| IUPAC Name | propane-1,1-diol;propane-1,3-diol |
| SMILES | CCC(O)O.OCCCO |
| InChI | InChI=1S/2C3H8O2/c1-2-3(4)5;4-2-1-3-5/h3-5H,2H2,1H3;4-5H,1-3H2 |
| InChIKey | YHLBDCUXFZRLFT-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze propane-1,1-diol;propane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propane-1,1-diol;propane-1,3-diol?
The IUPAC name of propane-1,1-diol;propane-1,3-diol (CID 23174644) is propane-1,1-diol;propane-1,3-diol.
What is the SMILES notation for propane-1,1-diol;propane-1,3-diol?
The canonical SMILES for propane-1,1-diol;propane-1,3-diol is CCC(O)O.OCCCO.
What is the InChIKey of propane-1,1-diol;propane-1,3-diol?
The InChIKey is YHLBDCUXFZRLFT-UHFFFAOYSA-N. The full InChI is InChI=1S/2C3H8O2/c1-2-3(4)5;4-2-1-3-5/h3-5H,2H2,1H3;4-5H,1-3H2.
What are the key properties of propane-1,1-diol;propane-1,3-diol?
propane-1,1-diol;propane-1,3-diol has a molecular weight of 152.19 g/mol, XLogP of -0.93, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propane-1,1-diol;propane-1,3-diol is sourced from PubChem (CID 23174644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).