About 1-phenyl-2-(5-pyrrolidin-1-ium-1-ylcyclohexa-1,5-dien-1-yl)hydrazine
1-phenyl-2-(5-pyrrolidin-1-ium-1-ylcyclohexa-1,5-dien-1-yl)hydrazine (PubChem CID 2317469) has the molecular formula C16H22N3+
and a molecular weight of 256.37 g/mol. Its IUPAC name is 1-phenyl-2-(5-pyrrolidin-1-ium-1-ylcyclohexa-1,5-dien-1-yl)hydrazine.
Molecular Properties
| Compound Name | 1-phenyl-2-(5-pyrrolidin-1-ium-1-ylcyclohexa-1,5-dien-1-yl)hydrazine |
| PubChem CID | 2317469 |
| Molecular Formula | C16H22N3+ |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | 1-phenyl-2-(5-pyrrolidin-1-ium-1-ylcyclohexa-1,5-dien-1-yl)hydrazine |
| SMILES | C1=C(NNc2ccccc2)C=C([NH+]2CCCC2)CC1 |
| InChI | InChI=1S/C16H21N3/c1-2-7-14(8-3-1)17-18-15-9-6-10-16(13-15)19-11-4-5-12-19/h1-3,7-9,13,17-18H,4-6,10-12H2/p+1 |
| InChIKey | WODMZXOQANFCGA-UHFFFAOYSA-O |
| XLogP | 1.84 |
| TPSA | 28.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-phenyl-2-(5-pyrrolidin-1-ium-1-ylcyclohexa-1,5-dien-1-yl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-2-(5-pyrrolidin-1-ium-1-ylcyclohexa-1,5-dien-1-yl)hydrazine?
The IUPAC name of 1-phenyl-2-(5-pyrrolidin-1-ium-1-ylcyclohexa-1,5-dien-1-yl)hydrazine (CID 2317469) is 1-phenyl-2-(5-pyrrolidin-1-ium-1-ylcyclohexa-1,5-dien-1-yl)hydrazine.
What is the SMILES notation for 1-phenyl-2-(5-pyrrolidin-1-ium-1-ylcyclohexa-1,5-dien-1-yl)hydrazine?
The canonical SMILES for 1-phenyl-2-(5-pyrrolidin-1-ium-1-ylcyclohexa-1,5-dien-1-yl)hydrazine is C1=C(NNc2ccccc2)C=C([NH+]2CCCC2)CC1.
What is the InChIKey of 1-phenyl-2-(5-pyrrolidin-1-ium-1-ylcyclohexa-1,5-dien-1-yl)hydrazine?
The InChIKey is WODMZXOQANFCGA-UHFFFAOYSA-O. The full InChI is InChI=1S/C16H21N3/c1-2-7-14(8-3-1)17-18-15-9-6-10-16(13-15)19-11-4-5-12-19/h1-3,7-9,13,17-18H,4-6,10-12H2/p+1.
What are the key properties of 1-phenyl-2-(5-pyrrolidin-1-ium-1-ylcyclohexa-1,5-dien-1-yl)hydrazine?
1-phenyl-2-(5-pyrrolidin-1-ium-1-ylcyclohexa-1,5-dien-1-yl)hydrazine has a molecular weight of 256.37 g/mol, XLogP of 1.84, 4 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-2-(5-pyrrolidin-1-ium-1-ylcyclohexa-1,5-dien-1-yl)hydrazine is sourced from PubChem (CID 2317469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).