About (E)-4-(dimethylamino)-4-ethyl-2,5-dimethylhept-2-enoic acid
(E)-4-(dimethylamino)-4-ethyl-2,5-dimethylhept-2-enoic acid (PubChem CID 23174822) has the molecular formula C13H25NO2
and a molecular weight of 227.35 g/mol. Its IUPAC name is (E)-4-(dimethylamino)-4-ethyl-2,5-dimethylhept-2-enoic acid.
Molecular Properties
| Compound Name | (E)-4-(dimethylamino)-4-ethyl-2,5-dimethylhept-2-enoic acid |
| PubChem CID | 23174822 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | (E)-4-(dimethylamino)-4-ethyl-2,5-dimethylhept-2-enoic acid |
| SMILES | CCC(C)C(/C=C(\C)C(=O)O)(CC)N(C)C |
| InChI | InChI=1S/C13H25NO2/c1-7-11(4)13(8-2,14(5)6)9-10(3)12(15)16/h9,11H,7-8H2,1-6H3,(H,15,16)/b10-9+ |
| InChIKey | HDKQOUKWCORDNB-MDZDMXLPSA-N |
| XLogP | 2.77 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-(dimethylamino)-4-ethyl-2,5-dimethylhept-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-(dimethylamino)-4-ethyl-2,5-dimethylhept-2-enoic acid?
The IUPAC name of (E)-4-(dimethylamino)-4-ethyl-2,5-dimethylhept-2-enoic acid (CID 23174822) is (E)-4-(dimethylamino)-4-ethyl-2,5-dimethylhept-2-enoic acid.
What is the SMILES notation for (E)-4-(dimethylamino)-4-ethyl-2,5-dimethylhept-2-enoic acid?
The canonical SMILES for (E)-4-(dimethylamino)-4-ethyl-2,5-dimethylhept-2-enoic acid is CCC(C)C(/C=C(\C)C(=O)O)(CC)N(C)C.
What is the InChIKey of (E)-4-(dimethylamino)-4-ethyl-2,5-dimethylhept-2-enoic acid?
The InChIKey is HDKQOUKWCORDNB-MDZDMXLPSA-N. The full InChI is InChI=1S/C13H25NO2/c1-7-11(4)13(8-2,14(5)6)9-10(3)12(15)16/h9,11H,7-8H2,1-6H3,(H,15,16)/b10-9+.
What are the key properties of (E)-4-(dimethylamino)-4-ethyl-2,5-dimethylhept-2-enoic acid?
(E)-4-(dimethylamino)-4-ethyl-2,5-dimethylhept-2-enoic acid has a molecular weight of 227.35 g/mol, XLogP of 2.77, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-(dimethylamino)-4-ethyl-2,5-dimethylhept-2-enoic acid is sourced from PubChem (CID 23174822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).