About 1-ethynylcyclohexan-1-ol;platinum(2+)
1-ethynylcyclohexan-1-ol;platinum(2+) (PubChem CID 23175181) has the molecular formula C8H12OPt+2
and a molecular weight of 319.26 g/mol. Its IUPAC name is 1-ethynylcyclohexan-1-ol;platinum(2+).
Molecular Properties
| Compound Name | 1-ethynylcyclohexan-1-ol;platinum(2+) |
| PubChem CID | 23175181 |
| Molecular Formula | C8H12OPt+2 |
| Molecular Weight | 319.26 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | 1-ethynylcyclohexan-1-ol;platinum(2+) |
| SMILES | C#CC1(O)CCCCC1.[Pt+2] |
| InChI | InChI=1S/C8H12O.Pt/c1-2-8(9)6-4-3-5-7-8;/h1,9H,3-7H2;/q;+2 |
| InChIKey | LHXBBYVBYUAZDM-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.26 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-ethynylcyclohexan-1-ol;platinum(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethynylcyclohexan-1-ol;platinum(2+)?
The IUPAC name of 1-ethynylcyclohexan-1-ol;platinum(2+) (CID 23175181) is 1-ethynylcyclohexan-1-ol;platinum(2+).
What is the SMILES notation for 1-ethynylcyclohexan-1-ol;platinum(2+)?
The canonical SMILES for 1-ethynylcyclohexan-1-ol;platinum(2+) is C#CC1(O)CCCCC1.[Pt+2].
What is the InChIKey of 1-ethynylcyclohexan-1-ol;platinum(2+)?
The InChIKey is LHXBBYVBYUAZDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O.Pt/c1-2-8(9)6-4-3-5-7-8;/h1,9H,3-7H2;/q;+2.
What are the key properties of 1-ethynylcyclohexan-1-ol;platinum(2+)?
1-ethynylcyclohexan-1-ol;platinum(2+) has a molecular weight of 319.26 g/mol, XLogP of 1.31, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethynylcyclohexan-1-ol;platinum(2+) is sourced from PubChem (CID 23175181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).