About 3-pentyliminobutanoic acid
3-pentyliminobutanoic acid (PubChem CID 23175555) has the molecular formula C9H17NO2
and a molecular weight of 171.24 g/mol. Its IUPAC name is 3-pentyliminobutanoic acid.
Molecular Properties
| Compound Name | 3-pentyliminobutanoic acid |
| PubChem CID | 23175555 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | 3-pentyliminobutanoic acid |
| SMILES | CCCCC/N=C(\C)CC(=O)O |
| InChI | InChI=1S/C9H17NO2/c1-3-4-5-6-10-8(2)7-9(11)12/h3-7H2,1-2H3,(H,11,12)/b10-8+ |
| InChIKey | MZWHCZSZLOQCES-CSKARUKUSA-N |
| XLogP | 2.11 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-pentyliminobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pentyliminobutanoic acid?
The IUPAC name of 3-pentyliminobutanoic acid (CID 23175555) is 3-pentyliminobutanoic acid.
What is the SMILES notation for 3-pentyliminobutanoic acid?
The canonical SMILES for 3-pentyliminobutanoic acid is CCCCC/N=C(\C)CC(=O)O.
What is the InChIKey of 3-pentyliminobutanoic acid?
The InChIKey is MZWHCZSZLOQCES-CSKARUKUSA-N. The full InChI is InChI=1S/C9H17NO2/c1-3-4-5-6-10-8(2)7-9(11)12/h3-7H2,1-2H3,(H,11,12)/b10-8+.
What are the key properties of 3-pentyliminobutanoic acid?
3-pentyliminobutanoic acid has a molecular weight of 171.24 g/mol, XLogP of 2.11, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pentyliminobutanoic acid is sourced from PubChem (CID 23175555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).