C34H28N4S2 — CID 23175626
2-[(E)-4-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]but-2-enyl]sulfanyl-4,5-diphenyl-1H-imidazole (PubChem CID 23175626) has the molecular formula C34H28N4S2 and a molecular weight of 556.76 g/mol. Its IUPAC name is 2-[(E)-4-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]but-2-enyl]sulfanyl-4,5-diphenyl-1H-imidazole.
| Compound Name | 2-[(E)-4-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]but-2-enyl]sulfanyl-4,5-diphenyl-1H-imidazole |
|---|---|
| PubChem CID | 23175626 |
| Molecular Formula | C34H28N4S2 |
| Molecular Weight | 556.76 g/mol |
| Exact Mass | 556.18 |
| IUPAC Name | 2-[(E)-4-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]but-2-enyl]sulfanyl-4,5-diphenyl-1H-imidazole |
| SMILES | C(=C/CSc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1)\CSc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C34H28N4S2/c1-5-15-25(16-6-1)29-30(26-17-7-2-8-18-26)36-33(35-29)39-23-13-14-24-40-34-37-31(27-19-9-3-10-20-27)32(38-34)28-21-11-4-12-22-28/h1-22H,23-24H2,(H,35,36)(H,37,38)/b14-13+ |
| InChIKey | WEFQUVMBCALHCD-BUHFOSPRSA-N |
| XLogP | 9.24 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.76 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|