About 2-[4-(1-methylimidazol-2-yl)sulfonylbutylsulfonyl]-4,5-diphenyl-1H-imidazole
2-[4-(1-methylimidazol-2-yl)sulfonylbutylsulfonyl]-4,5-diphenyl-1H-imidazole (PubChem CID 23175642) has the molecular formula C23H24N4O4S2
and a molecular weight of 484.60 g/mol. Its IUPAC name is 2-[4-(1-methylimidazol-2-yl)sulfonylbutylsulfonyl]-4,5-diphenyl-1H-imidazole.
Molecular Properties
| Compound Name | 2-[4-(1-methylimidazol-2-yl)sulfonylbutylsulfonyl]-4,5-diphenyl-1H-imidazole |
| PubChem CID | 23175642 |
| Molecular Formula | C23H24N4O4S2 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | 2-[4-(1-methylimidazol-2-yl)sulfonylbutylsulfonyl]-4,5-diphenyl-1H-imidazole |
| SMILES | Cn1ccnc1S(=O)(=O)CCCCS(=O)(=O)c1nc(-c2ccccc2)c(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C23H24N4O4S2/c1-27-15-14-24-23(27)33(30,31)17-9-8-16-32(28,29)22-25-20(18-10-4-2-5-11-18)21(26-22)19-12-6-3-7-13-19/h2-7,10-15H,8-9,16-17H2,1H3,(H,25,26) |
| InChIKey | VHMRAZPBGVCDQH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 114.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(1-methylimidazol-2-yl)sulfonylbutylsulfonyl]-4,5-diphenyl-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(1-methylimidazol-2-yl)sulfonylbutylsulfonyl]-4,5-diphenyl-1H-imidazole?
The IUPAC name of 2-[4-(1-methylimidazol-2-yl)sulfonylbutylsulfonyl]-4,5-diphenyl-1H-imidazole (CID 23175642) is 2-[4-(1-methylimidazol-2-yl)sulfonylbutylsulfonyl]-4,5-diphenyl-1H-imidazole.
What is the SMILES notation for 2-[4-(1-methylimidazol-2-yl)sulfonylbutylsulfonyl]-4,5-diphenyl-1H-imidazole?
The canonical SMILES for 2-[4-(1-methylimidazol-2-yl)sulfonylbutylsulfonyl]-4,5-diphenyl-1H-imidazole is Cn1ccnc1S(=O)(=O)CCCCS(=O)(=O)c1nc(-c2ccccc2)c(-c2ccccc2)[nH]1.
What is the InChIKey of 2-[4-(1-methylimidazol-2-yl)sulfonylbutylsulfonyl]-4,5-diphenyl-1H-imidazole?
The InChIKey is VHMRAZPBGVCDQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24N4O4S2/c1-27-15-14-24-23(27)33(30,31)17-9-8-16-32(28,29)22-25-20(18-10-4-2-5-11-18)21(26-22)19-12-6-3-7-13-19/h2-7,10-15H,8-9,16-17H2,1H3,(H,25,26).
What are the key properties of 2-[4-(1-methylimidazol-2-yl)sulfonylbutylsulfonyl]-4,5-diphenyl-1H-imidazole?
2-[4-(1-methylimidazol-2-yl)sulfonylbutylsulfonyl]-4,5-diphenyl-1H-imidazole has a molecular weight of 484.60 g/mol, XLogP of 3.51, 9 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(1-methylimidazol-2-yl)sulfonylbutylsulfonyl]-4,5-diphenyl-1H-imidazole is sourced from PubChem (CID 23175642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).