About 2-[4-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]butylsulfinyl]pyridine
2-[4-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]butylsulfinyl]pyridine (PubChem CID 23175670) has the molecular formula C24H23N3OS2
and a molecular weight of 433.60 g/mol. Its IUPAC name is 2-[4-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]butylsulfinyl]pyridine.
Molecular Properties
| Compound Name | 2-[4-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]butylsulfinyl]pyridine |
| PubChem CID | 23175670 |
| Molecular Formula | C24H23N3OS2 |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 2-[4-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]butylsulfinyl]pyridine |
| SMILES | O=S(CCCCSc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1)c1ccccn1 |
| InChI | InChI=1S/C24H23N3OS2/c28-30(21-15-7-8-16-25-21)18-10-9-17-29-24-26-22(19-11-3-1-4-12-19)23(27-24)20-13-5-2-6-14-20/h1-8,11-16H,9-10,17-18H2,(H,26,27) |
| InChIKey | KXBKELHMYKQFRN-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]butylsulfinyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]butylsulfinyl]pyridine?
The IUPAC name of 2-[4-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]butylsulfinyl]pyridine (CID 23175670) is 2-[4-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]butylsulfinyl]pyridine.
What is the SMILES notation for 2-[4-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]butylsulfinyl]pyridine?
The canonical SMILES for 2-[4-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]butylsulfinyl]pyridine is O=S(CCCCSc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1)c1ccccn1.
What is the InChIKey of 2-[4-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]butylsulfinyl]pyridine?
The InChIKey is KXBKELHMYKQFRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23N3OS2/c28-30(21-15-7-8-16-25-21)18-10-9-17-29-24-26-22(19-11-3-1-4-12-19)23(27-24)20-13-5-2-6-14-20/h1-8,11-16H,9-10,17-18H2,(H,26,27).
What are the key properties of 2-[4-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]butylsulfinyl]pyridine?
2-[4-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]butylsulfinyl]pyridine has a molecular weight of 433.60 g/mol, XLogP of 5.82, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]butylsulfinyl]pyridine is sourced from PubChem (CID 23175670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).