About 2-[6-(2-ethylimidazol-1-yl)hexylsulfanyl]-4,5-diphenyl-1H-imidazole
2-[6-(2-ethylimidazol-1-yl)hexylsulfanyl]-4,5-diphenyl-1H-imidazole (PubChem CID 23175748) has the molecular formula C26H30N4S
and a molecular weight of 430.62 g/mol. Its IUPAC name is 2-[6-(2-ethylimidazol-1-yl)hexylsulfanyl]-4,5-diphenyl-1H-imidazole.
Molecular Properties
| Compound Name | 2-[6-(2-ethylimidazol-1-yl)hexylsulfanyl]-4,5-diphenyl-1H-imidazole |
| PubChem CID | 23175748 |
| Molecular Formula | C26H30N4S |
| Molecular Weight | 430.62 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | 2-[6-(2-ethylimidazol-1-yl)hexylsulfanyl]-4,5-diphenyl-1H-imidazole |
| SMILES | CCc1nccn1CCCCCCSc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C26H30N4S/c1-2-23-27-17-19-30(23)18-11-3-4-12-20-31-26-28-24(21-13-7-5-8-14-21)25(29-26)22-15-9-6-10-16-22/h5-10,13-17,19H,2-4,11-12,18,20H2,1H3,(H,28,29) |
| InChIKey | GIGIMVRJZYMPBJ-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.62 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[6-(2-ethylimidazol-1-yl)hexylsulfanyl]-4,5-diphenyl-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-(2-ethylimidazol-1-yl)hexylsulfanyl]-4,5-diphenyl-1H-imidazole?
The IUPAC name of 2-[6-(2-ethylimidazol-1-yl)hexylsulfanyl]-4,5-diphenyl-1H-imidazole (CID 23175748) is 2-[6-(2-ethylimidazol-1-yl)hexylsulfanyl]-4,5-diphenyl-1H-imidazole.
What is the SMILES notation for 2-[6-(2-ethylimidazol-1-yl)hexylsulfanyl]-4,5-diphenyl-1H-imidazole?
The canonical SMILES for 2-[6-(2-ethylimidazol-1-yl)hexylsulfanyl]-4,5-diphenyl-1H-imidazole is CCc1nccn1CCCCCCSc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1.
What is the InChIKey of 2-[6-(2-ethylimidazol-1-yl)hexylsulfanyl]-4,5-diphenyl-1H-imidazole?
The InChIKey is GIGIMVRJZYMPBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H30N4S/c1-2-23-27-17-19-30(23)18-11-3-4-12-20-31-26-28-24(21-13-7-5-8-14-21)25(29-26)22-15-9-6-10-16-22/h5-10,13-17,19H,2-4,11-12,18,20H2,1H3,(H,28,29).
What are the key properties of 2-[6-(2-ethylimidazol-1-yl)hexylsulfanyl]-4,5-diphenyl-1H-imidazole?
2-[6-(2-ethylimidazol-1-yl)hexylsulfanyl]-4,5-diphenyl-1H-imidazole has a molecular weight of 430.62 g/mol, XLogP of 6.86, 11 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-(2-ethylimidazol-1-yl)hexylsulfanyl]-4,5-diphenyl-1H-imidazole is sourced from PubChem (CID 23175748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).