About 3-methyl-1,3-oxazolidin-2-one;1,3-oxazolidin-2-one
3-methyl-1,3-oxazolidin-2-one;1,3-oxazolidin-2-one (PubChem CID 23176876) has the molecular formula C7H12N2O4
and a molecular weight of 188.18 g/mol. Its IUPAC name is 3-methyl-1,3-oxazolidin-2-one;1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 3-methyl-1,3-oxazolidin-2-one;1,3-oxazolidin-2-one |
| PubChem CID | 23176876 |
| Molecular Formula | C7H12N2O4 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 3-methyl-1,3-oxazolidin-2-one;1,3-oxazolidin-2-one |
| SMILES | CN1CCOC1=O.O=C1NCCO1 |
| InChI | InChI=1S/C4H7NO2.C3H5NO2/c1-5-2-3-7-4(5)6;5-3-4-1-2-6-3/h2-3H2,1H3;1-2H2,(H,4,5) |
| InChIKey | XJEKGBMZTGNQNA-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methyl-1,3-oxazolidin-2-one;1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1,3-oxazolidin-2-one;1,3-oxazolidin-2-one?
The IUPAC name of 3-methyl-1,3-oxazolidin-2-one;1,3-oxazolidin-2-one (CID 23176876) is 3-methyl-1,3-oxazolidin-2-one;1,3-oxazolidin-2-one.
What is the SMILES notation for 3-methyl-1,3-oxazolidin-2-one;1,3-oxazolidin-2-one?
The canonical SMILES for 3-methyl-1,3-oxazolidin-2-one;1,3-oxazolidin-2-one is CN1CCOC1=O.O=C1NCCO1.
What is the InChIKey of 3-methyl-1,3-oxazolidin-2-one;1,3-oxazolidin-2-one?
The InChIKey is XJEKGBMZTGNQNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO2.C3H5NO2/c1-5-2-3-7-4(5)6;5-3-4-1-2-6-3/h2-3H2,1H3;1-2H2,(H,4,5).
What are the key properties of 3-methyl-1,3-oxazolidin-2-one;1,3-oxazolidin-2-one?
3-methyl-1,3-oxazolidin-2-one;1,3-oxazolidin-2-one has a molecular weight of 188.18 g/mol, XLogP of -0.21, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1,3-oxazolidin-2-one;1,3-oxazolidin-2-one is sourced from PubChem (CID 23176876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).