C9H13Cl2F3O3S — CID 23177061
[2,2-dichloro-1-(2,2-dimethylcyclopropyl)-3,3,3-trifluoropropyl] methanesulfonate (PubChem CID 23177061) has the molecular formula C9H13Cl2F3O3S and a molecular weight of 329.17 g/mol. Its IUPAC name is [2,2-dichloro-1-(2,2-dimethylcyclopropyl)-3,3,3-trifluoropropyl] methanesulfonate.
| Compound Name | [2,2-dichloro-1-(2,2-dimethylcyclopropyl)-3,3,3-trifluoropropyl] methanesulfonate |
|---|---|
| PubChem CID | 23177061 |
| Molecular Formula | C9H13Cl2F3O3S |
| Molecular Weight | 329.17 g/mol |
| Exact Mass | 327.99 |
| IUPAC Name | [2,2-dichloro-1-(2,2-dimethylcyclopropyl)-3,3,3-trifluoropropyl] methanesulfonate |
| SMILES | CC1(C)CC1C(OS(C)(=O)=O)C(Cl)(Cl)C(F)(F)F |
| InChI | InChI=1S/C9H13Cl2F3O3S/c1-7(2)4-5(7)6(17-18(3,15)16)8(10,11)9(12,13)14/h5-6H,4H2,1-3H3 |
| InChIKey | QQJXOTISBFTACB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.17 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|