About 1-ethyl-4,4-dimethyl-6-(2-phenyl-1H-imidazol-5-yl)-3H-quinolin-2-one
1-ethyl-4,4-dimethyl-6-(2-phenyl-1H-imidazol-5-yl)-3H-quinolin-2-one (PubChem CID 23177813) has the molecular formula C22H23N3O
and a molecular weight of 345.45 g/mol. Its IUPAC name is 1-ethyl-4,4-dimethyl-6-(2-phenyl-1H-imidazol-5-yl)-3H-quinolin-2-one.
Molecular Properties
| Compound Name | 1-ethyl-4,4-dimethyl-6-(2-phenyl-1H-imidazol-5-yl)-3H-quinolin-2-one |
| PubChem CID | 23177813 |
| Molecular Formula | C22H23N3O |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | 1-ethyl-4,4-dimethyl-6-(2-phenyl-1H-imidazol-5-yl)-3H-quinolin-2-one |
| SMILES | CCN1C(=O)CC(C)(C)c2cc(-c3cnc(-c4ccccc4)[nH]3)ccc21 |
| InChI | InChI=1S/C22H23N3O/c1-4-25-19-11-10-16(12-17(19)22(2,3)13-20(25)26)18-14-23-21(24-18)15-8-6-5-7-9-15/h5-12,14H,4,13H2,1-3H3,(H,23,24) |
| InChIKey | NTZVOSKGNUTCEH-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-ethyl-4,4-dimethyl-6-(2-phenyl-1H-imidazol-5-yl)-3H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4,4-dimethyl-6-(2-phenyl-1H-imidazol-5-yl)-3H-quinolin-2-one?
The IUPAC name of 1-ethyl-4,4-dimethyl-6-(2-phenyl-1H-imidazol-5-yl)-3H-quinolin-2-one (CID 23177813) is 1-ethyl-4,4-dimethyl-6-(2-phenyl-1H-imidazol-5-yl)-3H-quinolin-2-one.
What is the SMILES notation for 1-ethyl-4,4-dimethyl-6-(2-phenyl-1H-imidazol-5-yl)-3H-quinolin-2-one?
The canonical SMILES for 1-ethyl-4,4-dimethyl-6-(2-phenyl-1H-imidazol-5-yl)-3H-quinolin-2-one is CCN1C(=O)CC(C)(C)c2cc(-c3cnc(-c4ccccc4)[nH]3)ccc21.
What is the InChIKey of 1-ethyl-4,4-dimethyl-6-(2-phenyl-1H-imidazol-5-yl)-3H-quinolin-2-one?
The InChIKey is NTZVOSKGNUTCEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23N3O/c1-4-25-19-11-10-16(12-17(19)22(2,3)13-20(25)26)18-14-23-21(24-18)15-8-6-5-7-9-15/h5-12,14H,4,13H2,1-3H3,(H,23,24).
What are the key properties of 1-ethyl-4,4-dimethyl-6-(2-phenyl-1H-imidazol-5-yl)-3H-quinolin-2-one?
1-ethyl-4,4-dimethyl-6-(2-phenyl-1H-imidazol-5-yl)-3H-quinolin-2-one has a molecular weight of 345.45 g/mol, XLogP of 4.78, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4,4-dimethyl-6-(2-phenyl-1H-imidazol-5-yl)-3H-quinolin-2-one is sourced from PubChem (CID 23177813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).