About 8-methyl-9b-(3-methylsulfonylphenyl)-2,3-dihydro-1H-imidazo[2,1-a]isoindol-5-one
8-methyl-9b-(3-methylsulfonylphenyl)-2,3-dihydro-1H-imidazo[2,1-a]isoindol-5-one (PubChem CID 23178389) has the molecular formula C18H18N2O3S
and a molecular weight of 342.42 g/mol. Its IUPAC name is 8-methyl-9b-(3-methylsulfonylphenyl)-2,3-dihydro-1H-imidazo[2,1-a]isoindol-5-one.
Molecular Properties
| Compound Name | 8-methyl-9b-(3-methylsulfonylphenyl)-2,3-dihydro-1H-imidazo[2,1-a]isoindol-5-one |
| PubChem CID | 23178389 |
| Molecular Formula | C18H18N2O3S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 8-methyl-9b-(3-methylsulfonylphenyl)-2,3-dihydro-1H-imidazo[2,1-a]isoindol-5-one |
| SMILES | Cc1ccc2c(c1)C1(c3cccc(S(C)(=O)=O)c3)NCCN1C2=O |
| InChI | InChI=1S/C18H18N2O3S/c1-12-6-7-15-16(10-12)18(19-8-9-20(18)17(15)21)13-4-3-5-14(11-13)24(2,22)23/h3-7,10-11,19H,8-9H2,1-2H3 |
| InChIKey | JYHHJDOOIOFLKV-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-methyl-9b-(3-methylsulfonylphenyl)-2,3-dihydro-1H-imidazo[2,1-a]isoindol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-9b-(3-methylsulfonylphenyl)-2,3-dihydro-1H-imidazo[2,1-a]isoindol-5-one?
The IUPAC name of 8-methyl-9b-(3-methylsulfonylphenyl)-2,3-dihydro-1H-imidazo[2,1-a]isoindol-5-one (CID 23178389) is 8-methyl-9b-(3-methylsulfonylphenyl)-2,3-dihydro-1H-imidazo[2,1-a]isoindol-5-one.
What is the SMILES notation for 8-methyl-9b-(3-methylsulfonylphenyl)-2,3-dihydro-1H-imidazo[2,1-a]isoindol-5-one?
The canonical SMILES for 8-methyl-9b-(3-methylsulfonylphenyl)-2,3-dihydro-1H-imidazo[2,1-a]isoindol-5-one is Cc1ccc2c(c1)C1(c3cccc(S(C)(=O)=O)c3)NCCN1C2=O.
What is the InChIKey of 8-methyl-9b-(3-methylsulfonylphenyl)-2,3-dihydro-1H-imidazo[2,1-a]isoindol-5-one?
The InChIKey is JYHHJDOOIOFLKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N2O3S/c1-12-6-7-15-16(10-12)18(19-8-9-20(18)17(15)21)13-4-3-5-14(11-13)24(2,22)23/h3-7,10-11,19H,8-9H2,1-2H3.
What are the key properties of 8-methyl-9b-(3-methylsulfonylphenyl)-2,3-dihydro-1H-imidazo[2,1-a]isoindol-5-one?
8-methyl-9b-(3-methylsulfonylphenyl)-2,3-dihydro-1H-imidazo[2,1-a]isoindol-5-one has a molecular weight of 342.42 g/mol, XLogP of 1.66, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-9b-(3-methylsulfonylphenyl)-2,3-dihydro-1H-imidazo[2,1-a]isoindol-5-one is sourced from PubChem (CID 23178389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).