C24H38O2 — CID 23179067
2-[(1E,3E,5E,7E)-9,9-diethoxy-3,7-dimethylnona-1,3,5,7-tetraenyl]-1,3,3-trimethylcyclohexene (PubChem CID 23179067) has the molecular formula C24H38O2 and a molecular weight of 358.57 g/mol. Its IUPAC name is 2-[(1E,3E,5E,7E)-9,9-diethoxy-3,7-dimethylnona-1,3,5,7-tetraenyl]-1,3,3-trimethylcyclohexene.
| Compound Name | 2-[(1E,3E,5E,7E)-9,9-diethoxy-3,7-dimethylnona-1,3,5,7-tetraenyl]-1,3,3-trimethylcyclohexene |
|---|---|
| PubChem CID | 23179067 |
| Molecular Formula | C24H38O2 |
| Molecular Weight | 358.57 g/mol |
| Exact Mass | 358.29 |
| IUPAC Name | 2-[(1E,3E,5E,7E)-9,9-diethoxy-3,7-dimethylnona-1,3,5,7-tetraenyl]-1,3,3-trimethylcyclohexene |
| SMILES | CCOC(/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C)OCC |
| InChI | InChI=1S/C24H38O2/c1-8-25-23(26-9-2)18-20(4)13-10-12-19(3)15-16-22-21(5)14-11-17-24(22,6)7/h10,12-13,15-16,18,23H,8-9,11,14,17H2,1-7H3/b13-10+,16-15+,19-12+,20-18+ |
| InChIKey | QBFQVZSULFGJTN-VVYUTNTRSA-N |
| XLogP | 6.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.57 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|