About 6,6-dimethyl-5,7-dihydro-1,3-benzothiazol-4-one
6,6-dimethyl-5,7-dihydro-1,3-benzothiazol-4-one (PubChem CID 23179489) has the molecular formula C9H11NOS
and a molecular weight of 181.26 g/mol. Its IUPAC name is 6,6-dimethyl-5,7-dihydro-1,3-benzothiazol-4-one.
Molecular Properties
| Compound Name | 6,6-dimethyl-5,7-dihydro-1,3-benzothiazol-4-one |
| PubChem CID | 23179489 |
| Molecular Formula | C9H11NOS |
| Molecular Weight | 181.26 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | 6,6-dimethyl-5,7-dihydro-1,3-benzothiazol-4-one |
| SMILES | CC1(C)CC(=O)c2ncsc2C1 |
| InChI | InChI=1S/C9H11NOS/c1-9(2)3-6(11)8-7(4-9)12-5-10-8/h5H,3-4H2,1-2H3 |
| InChIKey | IILAIHZIHKLXHT-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.26 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,6-dimethyl-5,7-dihydro-1,3-benzothiazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dimethyl-5,7-dihydro-1,3-benzothiazol-4-one?
The IUPAC name of 6,6-dimethyl-5,7-dihydro-1,3-benzothiazol-4-one (CID 23179489) is 6,6-dimethyl-5,7-dihydro-1,3-benzothiazol-4-one.
What is the SMILES notation for 6,6-dimethyl-5,7-dihydro-1,3-benzothiazol-4-one?
The canonical SMILES for 6,6-dimethyl-5,7-dihydro-1,3-benzothiazol-4-one is CC1(C)CC(=O)c2ncsc2C1.
What is the InChIKey of 6,6-dimethyl-5,7-dihydro-1,3-benzothiazol-4-one?
The InChIKey is IILAIHZIHKLXHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NOS/c1-9(2)3-6(11)8-7(4-9)12-5-10-8/h5H,3-4H2,1-2H3.
What are the key properties of 6,6-dimethyl-5,7-dihydro-1,3-benzothiazol-4-one?
6,6-dimethyl-5,7-dihydro-1,3-benzothiazol-4-one has a molecular weight of 181.26 g/mol, XLogP of 2.30, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dimethyl-5,7-dihydro-1,3-benzothiazol-4-one is sourced from PubChem (CID 23179489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).