C22H27NO3S2 — CID 23179996
2-but-3-enyl-2-[2-oxo-1-(4-propan-2-yl-1,3-benzothiazol-2-yl)-2-sulfanylethyl]hex-5-enoic acid (PubChem CID 23179996) has the molecular formula C22H27NO3S2 and a molecular weight of 417.60 g/mol. Its IUPAC name is 2-but-3-enyl-2-[2-oxo-1-(4-propan-2-yl-1,3-benzothiazol-2-yl)-2-sulfanylethyl]hex-5-enoic acid.
| Compound Name | 2-but-3-enyl-2-[2-oxo-1-(4-propan-2-yl-1,3-benzothiazol-2-yl)-2-sulfanylethyl]hex-5-enoic acid |
|---|---|
| PubChem CID | 23179996 |
| Molecular Formula | C22H27NO3S2 |
| Molecular Weight | 417.60 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 2-but-3-enyl-2-[2-oxo-1-(4-propan-2-yl-1,3-benzothiazol-2-yl)-2-sulfanylethyl]hex-5-enoic acid |
| SMILES | C=CCCC(CCC=C)(C(=O)O)C(C(=O)S)c1nc2c(C(C)C)cccc2s1 |
| InChI | InChI=1S/C22H27NO3S2/c1-5-7-12-22(21(25)26,13-8-6-2)17(20(24)27)19-23-18-15(14(3)4)10-9-11-16(18)28-19/h5-6,9-11,14,17H,1-2,7-8,12-13H2,3-4H3,(H,24,27)(H,25,26) |
| InChIKey | RBQWWXXIXHMILG-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.60 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|