C30H34O4 — CID 23180143
methyl 4-[8-(4-methoxy-4-oxobutyl)-8,16-dimethyl-16-pentacyclo[8.5.3.03,13.05,11.07,18]octadeca-1,3,5,7(18),10,12,14-heptaenyl]butanoate (PubChem CID 23180143) has the molecular formula C30H34O4 and a molecular weight of 458.60 g/mol. Its IUPAC name is methyl 4-[8-(4-methoxy-4-oxobutyl)-8,16-dimethyl-16-pentacyclo[8.5.3.03,13.05,11.07,18]octadeca-1,3,5,7(18),10,12,14-heptaenyl]butanoate.
| Compound Name | methyl 4-[8-(4-methoxy-4-oxobutyl)-8,16-dimethyl-16-pentacyclo[8.5.3.03,13.05,11.07,18]octadeca-1,3,5,7(18),10,12,14-heptaenyl]butanoate |
|---|---|
| PubChem CID | 23180143 |
| Molecular Formula | C30H34O4 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | methyl 4-[8-(4-methoxy-4-oxobutyl)-8,16-dimethyl-16-pentacyclo[8.5.3.03,13.05,11.07,18]octadeca-1,3,5,7(18),10,12,14-heptaenyl]butanoate |
| SMILES | COC(=O)CCCC1(C)Cc2c3cc4cc5cc1ccc5cc4c2CC3(C)CCCC(=O)OC |
| InChI | InChI=1S/C30H34O4/c1-29(11-5-7-27(31)33-3)18-25-24-17-30(2,12-6-8-28(32)34-4)26(25)16-21-13-20-14-22(29)10-9-19(20)15-23(21)24/h9-10,13-16H,5-8,11-12,17-18H2,1-4H3 |
| InChIKey | XKBJFXLNYSQUEL-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|