About [4-(5-nonoxy-2-pyridinyl)phenyl] 6-methyloctanoate
[4-(5-nonoxy-2-pyridinyl)phenyl] 6-methyloctanoate (PubChem CID 23181048) has the molecular formula C29H43NO3
and a molecular weight of 453.67 g/mol. Its IUPAC name is [4-(5-nonoxy-2-pyridinyl)phenyl] 6-methyloctanoate.
Molecular Properties
| Compound Name | [4-(5-nonoxy-2-pyridinyl)phenyl] 6-methyloctanoate |
| PubChem CID | 23181048 |
| Molecular Formula | C29H43NO3 |
| Molecular Weight | 453.67 g/mol |
| Exact Mass | 453.32 |
| IUPAC Name | [4-(5-nonoxy-2-pyridinyl)phenyl] 6-methyloctanoate |
| SMILES | CCCCCCCCCOc1ccc(-c2ccc(OC(=O)CCCCC(C)CC)cc2)nc1 |
| InChI | InChI=1S/C29H43NO3/c1-4-6-7-8-9-10-13-22-32-27-20-21-28(30-23-27)25-16-18-26(19-17-25)33-29(31)15-12-11-14-24(3)5-2/h16-21,23-24H,4-15,22H2,1-3H3 |
| InChIKey | HPNBWXRGGUYEPW-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.67 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(5-nonoxy-2-pyridinyl)phenyl] 6-methyloctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(5-nonoxy-2-pyridinyl)phenyl] 6-methyloctanoate?
The IUPAC name of [4-(5-nonoxy-2-pyridinyl)phenyl] 6-methyloctanoate (CID 23181048) is [4-(5-nonoxy-2-pyridinyl)phenyl] 6-methyloctanoate.
What is the SMILES notation for [4-(5-nonoxy-2-pyridinyl)phenyl] 6-methyloctanoate?
The canonical SMILES for [4-(5-nonoxy-2-pyridinyl)phenyl] 6-methyloctanoate is CCCCCCCCCOc1ccc(-c2ccc(OC(=O)CCCCC(C)CC)cc2)nc1.
What is the InChIKey of [4-(5-nonoxy-2-pyridinyl)phenyl] 6-methyloctanoate?
The InChIKey is HPNBWXRGGUYEPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H43NO3/c1-4-6-7-8-9-10-13-22-32-27-20-21-28(30-23-27)25-16-18-26(19-17-25)33-29(31)15-12-11-14-24(3)5-2/h16-21,23-24H,4-15,22H2,1-3H3.
What are the key properties of [4-(5-nonoxy-2-pyridinyl)phenyl] 6-methyloctanoate?
[4-(5-nonoxy-2-pyridinyl)phenyl] 6-methyloctanoate has a molecular weight of 453.67 g/mol, XLogP of 8.39, 17 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(5-nonoxy-2-pyridinyl)phenyl] 6-methyloctanoate is sourced from PubChem (CID 23181048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).