About 4-(difluoromethoxy)-N-(11H-pyrimido[1,2-b][2,4]benzodiazepin-6-ylidene)benzamide
4-(difluoromethoxy)-N-(11H-pyrimido[1,2-b][2,4]benzodiazepin-6-ylidene)benzamide (PubChem CID 2318308) has the molecular formula C20H14F2N4O2
and a molecular weight of 380.35 g/mol. Its IUPAC name is 4-(difluoromethoxy)-N-(11H-pyrimido[1,2-b][2,4]benzodiazepin-6-ylidene)benzamide.
Molecular Properties
| Compound Name | 4-(difluoromethoxy)-N-(11H-pyrimido[1,2-b][2,4]benzodiazepin-6-ylidene)benzamide |
| PubChem CID | 2318308 |
| Molecular Formula | C20H14F2N4O2 |
| Molecular Weight | 380.35 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 4-(difluoromethoxy)-N-(11H-pyrimido[1,2-b][2,4]benzodiazepin-6-ylidene)benzamide |
| SMILES | O=C(/N=C1\N=C2N=CC=CN2Cc2ccccc21)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C20H14F2N4O2/c21-19(22)28-15-8-6-13(7-9-15)18(27)24-17-16-5-2-1-4-14(16)12-26-11-3-10-23-20(26)25-17/h1-11,19H,12H2/b24-17- |
| InChIKey | TZWPEUGRVODKIZ-ULJHMMPZSA-N |
| XLogP | 3.64 |
| TPSA | 66.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(difluoromethoxy)-N-(11H-pyrimido[1,2-b][2,4]benzodiazepin-6-ylidene)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(difluoromethoxy)-N-(11H-pyrimido[1,2-b][2,4]benzodiazepin-6-ylidene)benzamide?
The IUPAC name of 4-(difluoromethoxy)-N-(11H-pyrimido[1,2-b][2,4]benzodiazepin-6-ylidene)benzamide (CID 2318308) is 4-(difluoromethoxy)-N-(11H-pyrimido[1,2-b][2,4]benzodiazepin-6-ylidene)benzamide.
What is the SMILES notation for 4-(difluoromethoxy)-N-(11H-pyrimido[1,2-b][2,4]benzodiazepin-6-ylidene)benzamide?
The canonical SMILES for 4-(difluoromethoxy)-N-(11H-pyrimido[1,2-b][2,4]benzodiazepin-6-ylidene)benzamide is O=C(/N=C1\N=C2N=CC=CN2Cc2ccccc21)c1ccc(OC(F)F)cc1.
What is the InChIKey of 4-(difluoromethoxy)-N-(11H-pyrimido[1,2-b][2,4]benzodiazepin-6-ylidene)benzamide?
The InChIKey is TZWPEUGRVODKIZ-ULJHMMPZSA-N. The full InChI is InChI=1S/C20H14F2N4O2/c21-19(22)28-15-8-6-13(7-9-15)18(27)24-17-16-5-2-1-4-14(16)12-26-11-3-10-23-20(26)25-17/h1-11,19H,12H2/b24-17-.
What are the key properties of 4-(difluoromethoxy)-N-(11H-pyrimido[1,2-b][2,4]benzodiazepin-6-ylidene)benzamide?
4-(difluoromethoxy)-N-(11H-pyrimido[1,2-b][2,4]benzodiazepin-6-ylidene)benzamide has a molecular weight of 380.35 g/mol, XLogP of 3.64, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(difluoromethoxy)-N-(11H-pyrimido[1,2-b][2,4]benzodiazepin-6-ylidene)benzamide is sourced from PubChem (CID 2318308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).