C29H21N6O4S+ — CID 23183920
2-[5-(1,3-benzodioxol-5-yl)-3-(4-nitronaphthalen-1-yl)tetrazol-2-ium-2-yl]-5,6,7,8-tetrahydrobenzo[f][1,3]benzothiazole (PubChem CID 23183920) has the molecular formula C29H21N6O4S+ and a molecular weight of 549.59 g/mol. Its IUPAC name is 2-[5-(1,3-benzodioxol-5-yl)-3-(4-nitronaphthalen-1-yl)tetrazol-2-ium-2-yl]-5,6,7,8-tetrahydrobenzo[f][1,3]benzothiazole.
| Compound Name | 2-[5-(1,3-benzodioxol-5-yl)-3-(4-nitronaphthalen-1-yl)tetrazol-2-ium-2-yl]-5,6,7,8-tetrahydrobenzo[f][1,3]benzothiazole |
|---|---|
| PubChem CID | 23183920 |
| Molecular Formula | C29H21N6O4S+ |
| Molecular Weight | 549.59 g/mol |
| Exact Mass | 549.13 |
| IUPAC Name | 2-[5-(1,3-benzodioxol-5-yl)-3-(4-nitronaphthalen-1-yl)tetrazol-2-ium-2-yl]-5,6,7,8-tetrahydrobenzo[f][1,3]benzothiazole |
| SMILES | O=[N+]([O-])c1ccc(-n2nc(-c3ccc4c(c3)OCO4)n[n+]2-c2nc3cc4c(cc3s2)CCCC4)c2ccccc12 |
| InChI | InChI=1S/C29H21N6O4S/c36-35(37)24-11-10-23(20-7-3-4-8-21(20)24)33-31-28(19-9-12-25-26(14-19)39-16-38-25)32-34(33)29-30-22-13-17-5-1-2-6-18(17)15-27(22)40-29/h3-4,7-15H,1-2,5-6,16H2/q+1 |
| InChIKey | ZLUVSCWVDDHWGL-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 109.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.59 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|