About 2-methyliminoacetate
2-methyliminoacetate (PubChem CID 23183978) has the molecular formula C3H4NO2-
and a molecular weight of 86.07 g/mol. Its IUPAC name is 2-methyliminoacetate.
Molecular Properties
| Compound Name | 2-methyliminoacetate |
| PubChem CID | 23183978 |
| Molecular Formula | C3H4NO2- |
| Molecular Weight | 86.07 g/mol |
| Exact Mass | 86.02 |
| IUPAC Name | 2-methyliminoacetate |
| SMILES | C/N=C/C(=O)[O-] |
| InChI | InChI=1S/C3H5NO2/c1-4-2-3(5)6/h2H,1H3,(H,5,6)/p-1/b4-2+ |
| InChIKey | SEXCGGHGAGDKHP-DUXPYHPUSA-M |
| XLogP | -1.56 |
| TPSA | 52.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 86.07 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methyliminoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyliminoacetate?
The IUPAC name of 2-methyliminoacetate (CID 23183978) is 2-methyliminoacetate.
What is the SMILES notation for 2-methyliminoacetate?
The canonical SMILES for 2-methyliminoacetate is C/N=C/C(=O)[O-].
What is the InChIKey of 2-methyliminoacetate?
The InChIKey is SEXCGGHGAGDKHP-DUXPYHPUSA-M. The full InChI is InChI=1S/C3H5NO2/c1-4-2-3(5)6/h2H,1H3,(H,5,6)/p-1/b4-2+.
What are the key properties of 2-methyliminoacetate?
2-methyliminoacetate has a molecular weight of 86.07 g/mol, XLogP of -1.56, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyliminoacetate is sourced from PubChem (CID 23183978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).