About 2-methyl-1,2-dihydropyrrol-3-one
2-methyl-1,2-dihydropyrrol-3-one (PubChem CID 23184788) has the molecular formula C5H7NO
and a molecular weight of 97.12 g/mol. Its IUPAC name is 2-methyl-1,2-dihydropyrrol-3-one.
Molecular Properties
| Compound Name | 2-methyl-1,2-dihydropyrrol-3-one |
| PubChem CID | 23184788 |
| Molecular Formula | C5H7NO |
| Molecular Weight | 97.12 g/mol |
| Exact Mass | 97.05 |
| IUPAC Name | 2-methyl-1,2-dihydropyrrol-3-one |
| SMILES | CC1NC=CC1=O |
| InChI | InChI=1S/C5H7NO/c1-4-5(7)2-3-6-4/h2-4,6H,1H3 |
| InChIKey | PREQXVAMOARGMD-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 97.12 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-1,2-dihydropyrrol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1,2-dihydropyrrol-3-one?
The IUPAC name of 2-methyl-1,2-dihydropyrrol-3-one (CID 23184788) is 2-methyl-1,2-dihydropyrrol-3-one.
What is the SMILES notation for 2-methyl-1,2-dihydropyrrol-3-one?
The canonical SMILES for 2-methyl-1,2-dihydropyrrol-3-one is CC1NC=CC1=O.
What is the InChIKey of 2-methyl-1,2-dihydropyrrol-3-one?
The InChIKey is PREQXVAMOARGMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NO/c1-4-5(7)2-3-6-4/h2-4,6H,1H3.
What are the key properties of 2-methyl-1,2-dihydropyrrol-3-one?
2-methyl-1,2-dihydropyrrol-3-one has a molecular weight of 97.12 g/mol, XLogP of 0.06, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1,2-dihydropyrrol-3-one is sourced from PubChem (CID 23184788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).