About 1H-pyridin-2-one
1H-pyridin-2-one (PubChem CID 23185161) has the molecular formula C10H10N2O2
and a molecular weight of 190.20 g/mol. Its IUPAC name is 1H-pyridin-2-one.
Molecular Properties
| Compound Name | 1H-pyridin-2-one |
| PubChem CID | 23185161 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 1H-pyridin-2-one |
| SMILES | O=c1cccc[nH]1.O=c1cccc[nH]1 |
| InChI | InChI=1S/2C5H5NO/c2*7-5-3-1-2-4-6-5/h2*1-4H,(H,6,7) |
| InChIKey | UJIBOGAQJRDRES-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyridin-2-one?
The IUPAC name of 1H-pyridin-2-one (CID 23185161) is 1H-pyridin-2-one.
What is the SMILES notation for 1H-pyridin-2-one?
The canonical SMILES for 1H-pyridin-2-one is O=c1cccc[nH]1.O=c1cccc[nH]1.
What is the InChIKey of 1H-pyridin-2-one?
The InChIKey is UJIBOGAQJRDRES-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H5NO/c2*7-5-3-1-2-4-6-5/h2*1-4H,(H,6,7).
What are the key properties of 1H-pyridin-2-one?
1H-pyridin-2-one has a molecular weight of 190.20 g/mol, XLogP of 0.75, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyridin-2-one is sourced from PubChem (CID 23185161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).